Få mere at vide
Clozapine, 97%, Thermo Scientific™
Potent, selective muscarinic antagonist
Brand: Thermo Scientific Alfa Aesar J61583.MC
| Mængde | 100mg |
|---|
Se flere versioner af dette produkt
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Kemiske identifikatorer
| C18H19ClN4 | |
| MFCD00153785 | |
| clozapine, leponex, clozapin, clozaril, fazaclo, clorazil, iprox, clozapinum, asaleptin, clozapina | |
| 3-chloro-6-(4-methylpiperazin-1-yl)-5H-benzo[b][1,4]benzodiazepine |
Tekniske data
| Clozapine | |
| C18H19ClN4 | |
| 100mg | |
| 14,2423 | |
| ZUXABONWMNSFBN-UHFFFAOYSA-N | |
| 3-chloro-6-(4-methylpiperazin-1-yl)-5H-benzo[b][1,4]benzodiazepine | |
| 2818 | |
| ≥98% |
| 5786-21-0 | |
| MFCD00153785 | |
| UN2811 | |
| clozapine, leponex, clozapin, clozaril, fazaclo, clorazil, iprox, clozapinum, asaleptin, clozapina | |
| CN1CCN(CC1)C2=C3C=CC=CC3=NC4=C(N2)C=C(C=C4)Cl | |
| 326.828 | |
| 326.83 |
Dit input er vigtigt for os. Udfyld denne formular for at give feedback relateret til indholdet på dette produkt.