missing translation for 'onlineSavingsMsg'
Få mere at vide
Få mere at vide
Clotrimazole, Thermo Scientific™
Specific inhibitor of calcium-activated potassium channels
Brand: Thermo Scientific Alfa Aesar J63895.14
| Mængde | 25g |
|---|
Denne vare kan ikke returneres.
Se returpolitik
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsClotrimazole is an imidazole derivative and an antifungal compound and a CYP (cytochrome P450) inhibitor. Clotrimazole has been shown to block the intermediate-conductance, IK1 channels (Ca2+ activated K+ channels), in cells such as erythrocytes. In vitro studies of various yeast strains have demonstrated susceptibility to clotrimazole. Clotrimazole is an activator of MB67 and an inhibitor of CYP3A4 and CYP51A1.
Solubility
Soluble in chloroform, DMSO, DMF and alcohols
Notes
Store at room temperature. Incompatible with oxidizing agents.
Kemiske identifikatorer
| 23593-75-1 | |
| 344.842 | |
| VNFPBHJOKIVQEB-UHFFFAOYSA-N | |
| 2812 | |
| 1-[(2-chlorophenyl)-diphenylmethyl]imidazole |
| C22H17ClN2 | |
| MFCD00057220 | |
| 1-[(2-Chlorophenyl)diphenylmethyl]-1H-imidazole; 1-(o-Chlorotrityl)imidazole | |
| CHEBI:3764 | |
| C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3Cl)N4C=CN=C4 |
Tekniske data
| Clotrimazole | |
| White | |
| C22H17ClN2 | |
| 14,2417 | |
| Soluble in chloroform, DMSO, DMF and alcohols | |
| C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3Cl)N4C=CN=C4 | |
| 344.842 | |
| CHEBI:3764 |
| 23593-75-1 | |
| 25g | |
| MFCD00057220 | |
| 1-[(2-Chlorophenyl)diphenylmethyl]-1H-imidazole; 1-(o-Chlorotrityl)imidazole | |
| VNFPBHJOKIVQEB-UHFFFAOYSA-N | |
| 1-[(2-chlorophenyl)-diphenylmethyl]imidazole | |
| 2812 | |
| 344.84 |
Produkttitel
Ved at klikke på Send, anerkender du, at du kan blive kontaktet af Fisher Scientific med hensyn til den feedback, du har givet i denne formular. Vi deler ikke dine oplysninger til andre formål. Alle angivne kontaktoplysninger skal også vedligeholdes i overensstemmelse med vores Privatlivspolitik.
Ser du en mulighed for forbedring?