missing translation for 'onlineSavingsMsg'
Få mere at vide
Få mere at vide
Chlortetracycline hydrochloride, Thermo Scientific™
Bacteriostatic antibiotic active against Gram-positive and Gram-negative bacteria
Brand: Thermo Scientific Alfa Aesar J60095.14
| Mængde | 25g |
|---|
Denne vare kan ikke returneres.
Se returpolitik
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsChlortetracycline was used in fluorescence assays to detect the Ca+2 influx required for the completion of acrosome reaction in human spermatozoa.
Solubility
Soluble in water
Notes
Light Sensitive. Store in dark. Store away from oxidizing agent.
Kemiske identifikatorer
| 64-72-2 | |
| 515.34 | |
| QYAPHLRPFNSDNH-CIVPRPTRSA-N | |
| 66577600 | |
| CC1(C2CC3C(C(=O)C(=C(C3(C(=O)C2=C(C4=C(C=CC(=C41)Cl)O)O)O)O)C(=O)N)N(C)C)O.Cl |
| C22H24Cl2N2O8 | |
| MFCD00082440 | |
| chlortetracycline hydrochloride, 4-epi-chlortetracycline hydrochloride, 2-amino hydroxy methylidene-7-chloro-4-dimethylamino-6,10,11,12a-tetrahydroxy-6-methyl-4,4a,5,5a-tetrahydrotetracene-1,3,12-trione hydrochloride, 2-azanyl oxidanyl methylidene-7-chloranyl-4-dimethylamino-6-methyl-6,10,11,12a-tetrakis oxidanyl-4,4a,5,5a-tetrahydrotetracene-1,3,12-trione hydrochloride | |
| (4S,4aR,5aS,6S,12aR)-7-chloro-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;hydrochloride |
Tekniske data
| Chlortetracycline hydrochloride | |
| C22H24Cl2N2O8 | |
| 25g | |
| Light sensitive | |
| chlortetracycline hydrochloride, 4-epi-chlortetracycline hydrochloride, 2-amino hydroxy methylidene-7-chloro-4-dimethylamino-6,10,11,12a-tetrahydroxy-6-methyl-4,4a,5,5a-tetrahydrotetracene-1,3,12-trione hydrochloride, 2-azanyl oxidanyl methylidene-7-chloranyl-4-dimethylamino-6-methyl-6,10,11,12a-tetrakis oxidanyl-4,4a,5,5a-tetrahydrotetracene-1,3,12-trione hydrochloride | |
| QYAPHLRPFNSDNH-CIVPRPTRSA-N | |
| (4S,4aR,5aS,6S,12aR)-7-chloro-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;hydrochloride | |
| 66577600 |
| 64-72-2 | |
| MFCD00082440 | |
| 3858364 | |
| 14,2192 | |
| Soluble in water | |
| CC1(C2CC3C(C(=O)C(=C(C3(C(=O)C2=C(C4=C(C=CC(=C41)Cl)O)O)O)O)C(=O)N)N(C)C)O.Cl | |
| 515.34 | |
| 515.34 |
Produkttitel
Ved at klikke på Send, anerkender du, at du kan blive kontaktet af Fisher Scientific med hensyn til den feedback, du har givet i denne formular. Vi deler ikke dine oplysninger til andre formål. Alle angivne kontaktoplysninger skal også vedligeholdes i overensstemmelse med vores Privatlivspolitik.
Ser du en mulighed for forbedring?