Learn More
Alfa Aesar™ Chlorobis(4-fluorophenyl)phosphine, 98%
Brand: Alfa Aesar™ H26953.MD
Additional Details : CAS Number : 23039-97-6 Weight : 0.00025kg Transport : UN number : 3265 Chem class : 8 Pack group : II
| Quantity | 250mg |
|---|
Description
ApplicationsIn chemical research. Used as an interphasic transfer catalyst, a polymerization catalyst, and a trans-halogenation catalyst. As a precursor to fire-retardant materials.
Solubility
Reacts with water.
Notes
Moisture Sensitive. Store in cool place. Keep container tightly closed in a dry and well-ventilated place. Store away from strong oxidizing agents, air, moisture.
Chemical Identifiers
| 23039-97-6 | |
| 256.617 | |
| PYFWYPBHSZATST-UHFFFAOYSA-N | |
| 4379931 | |
| C1=CC(=CC=C1F)P(C2=CC=C(C=C2)F)Cl |
| C12H8ClF2P | |
| MFCD04972302 | |
| bis 4-fluorophenyl chlorophosphine, chlorobis 4-fluorophenyl phosphine, chloro-bis 4-fluorophenyl phosphane, chlorobis 4-fluorophenyl phosphane, acmc-20alnm, bis-4-fluorophenyl chlorophosphine, phosphinous chloride,p,p-bis 4-fluorophenyl | |
| chloro-bis(4-fluorophenyl)phosphane |
Specifications
| Chlorobis(4-fluorophenyl)phosphine | |
| 250mg | |
| C12H8ClF2P | |
| UN3265 | |
| Reacts with water. | |
| C1=CC(=CC=C1F)P(C2=CC=C(C=C2)F)Cl | |
| 256.617 | |
| 256.62 |
| Moisture sensitive | |
| 23039-97-6 | |
| MFCD04972302 | |
| bis 4-fluorophenyl chlorophosphine, chlorobis 4-fluorophenyl phosphine, chloro-bis 4-fluorophenyl phosphane, chlorobis 4-fluorophenyl phosphane, acmc-20alnm, bis-4-fluorophenyl chlorophosphine, phosphinous chloride,p,p-bis 4-fluorophenyl | |
| PYFWYPBHSZATST-UHFFFAOYSA-N | |
| chloro-bis(4-fluorophenyl)phosphane | |
| 4379931 | |
| 98% |