Learn More
Celestine Blue, pure, ACROS Organics™
Brand: Acros Organics 195560500
Additional Details : CAS Number : 1562-90-9 Weight : 0.10000kg
| Quantity | 50g |
|---|
Chemical Identifiers
| 1562-90-9 | |
| 363.798 | |
| OJAMERVLRXYMPD-UHFFFAOYSA-N | |
| 7-(diethylamino)-4-hydroxy-3-oxophenoxazin-10-ium-1-carboxamide;chloride |
| C17H18ClN3O4 | |
| MFCD00011927 | |
| 54684697 | |
| CCN(CC)C1=CC2=C(C=C1)[NH+]=C3C(=CC(=O)C(=C3O2)O)C(=O)N.[Cl-] |
Specifications
| Celestine blue | |
| C17H18ClN3O4 | |
| 15, 1961 | |
| Authentic | |
| 7-(diethylamino)-4-hydroxy-3-oxophenoxazin-10-ium-1-carboxamide;chloride | |
| 638 to 648nm | |
| 363.79 | |
| Extra Pure | |
| 700 min. (in water) | |
| Black to Brown |
| 1562-90-9 | |
| MFCD00011927 | |
| OJAMERVLRXYMPD-UHFFFAOYSA-N | |
| CCN(CC)C1=CC2=C(C=C1)[NH+]=C3C(=CC(=O)C(=C3O2)O)C(=O)N.[Cl-] | |
| 363.798 | |
| 54684697 | |
| Powder | |
| Glass bottle | |
| Complies | |
| 50g |