Learn More
Celestine Blue, pure, ACROS Organics™
Brand: Acros Organics 195560100
Additional Details : CAS Number : 1562-90-9 Weight : 0.06000kg
Quantity | 10g |
---|
Chemical Identifiers
1562-90-9 | |
363.798 | |
OJAMERVLRXYMPD-UHFFFAOYSA-N | |
7-(diethylamino)-4-hydroxy-3-oxophenoxazin-10-ium-1-carboxamide;chloride |
C17H18ClN3O4 | |
MFCD00011927 | |
54684697 | |
CCN(CC)C1=CC2=C(C=C1)[NH+]=C3C(=CC(=O)C(=C3O2)O)C(=O)N.[Cl-] |
Specifications
Celestine blue | |
C17H18ClN3O4 | |
15, 1961 | |
Authentic | |
7-(diethylamino)-4-hydroxy-3-oxophenoxazin-10-ium-1-carboxamide;chloride | |
638 to 648nm | |
363.79 | |
Extra Pure | |
700 min. (in water) | |
Black to Brown |
1562-90-9 | |
MFCD00011927 | |
OJAMERVLRXYMPD-UHFFFAOYSA-N | |
CCN(CC)C1=CC2=C(C=C1)[NH+]=C3C(=CC(=O)C(=C3O2)O)C(=O)N.[Cl-] | |
363.798 | |
54684697 | |
Powder | |
Glass bottle | |
Complies | |
10g |