Få mere at vide
Cefazolin sodium salt, Thermo Scientific™
Inhibits bacterial cell wall synthesis
Brand: Thermo Scientific Alfa Aesar J65274.06
| Mængde | 5g |
|---|
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Tekniske data
| Cefazolin sodium salt | |
| White | |
| Light sensitive | |
| MFCD00056883 | |
| 14,1917 | |
| MTIAAUXSENDLGW-SLNAEPSVSA-N | |
| (6R,7R)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-7-[[2-(tetrazol-1-yl)acetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;molecular hydrogen;sodium | |
| 131673922 |
| 27164-46-1 | |
| 5g | |
| C14H16N8NaO4S3 | |
| 3585038 | |
| Cefamedin | |
| [HH].CC1=NN=C(S1)SCC2=C(N3C(C(C3=O)NC(=O)CN4C=NN=N4)SC2)C(=O)O.[Na] | |
| 479.504 | |
| 476.48 |
Dit input er vigtigt for os. Udfyld denne formular for at give feedback relateret til indholdet på dette produkt.