missing translation for 'onlineSavingsMsg'
Få mere at vide
Få mere at vide
Cefaclor, Thermo Scientific™
A second-generation cephalosporin antibiotic
Brand: Thermo Scientific Alfa Aesar J64252.03
| Mængde | 1g |
|---|
Denne vare kan ikke returneres.
Se returpolitik
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsCefaclor is used to study urinary tract, intra-abdominal, and Haemophilus influenzae infections. It is used to study the mechanism of human renal organic anion and peptide transporters such as hOAT1, hPEPT1, and hPEPT2 and to study the effects of inhibition of penicillin-binding proteins on bacterial cell wall mucopeptide synthesis.
Solubility
Soluble in 1N HCl
Notes
Stable under recommended storage conditions. Incompatible with oxidizing agents.
Kemiske identifikatorer
| 53994-73-3 | |
| 367.804 | |
| QYIYFLOTGYLRGG-GPCCPHFNSA-N | |
| 51039 | |
| (6R,7R)-7-[[(2R)-2-amino-2-phenylacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| C15H14ClN3O4S | |
| MFCD00151471 | |
| Panoral; (R)-3-Chloro-7-((S)-2-amino-2-phenylacetamido)-3-cephem-4-carboxylic acid | |
| CHEBI:3478 | |
| C1C(=C(N2C(S1)C(C2=O)NC(=O)C(C3=CC=CC=C3)N)C(=O)O)Cl |
Tekniske data
| Cefaclor | |
| White to Yellow | |
| C15H14ClN3O4S | |
| 8176092 | |
| Panoral; (R)-3-Chloro-7-((S)-2-amino-2-phenylacetamido)-3-cephem-4-carboxylic acid | |
| QYIYFLOTGYLRGG-GPCCPHFNSA-N | |
| (6R,7R)-7-[[(2R)-2-amino-2-phenylacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | |
| 51039 | |
| 367.81 |
| 53994-73-3 | |
| 1g | |
| MFCD00151471 | |
| 14,1912 | |
| Soluble in 1N HCl | |
| C1C(=C(N2C(S1)C(C2=O)NC(=O)C(C3=CC=CC=C3)N)C(=O)O)Cl | |
| 367.804 | |
| CHEBI:3478 |
Produkttitel
Ved at klikke på Send, anerkender du, at du kan blive kontaktet af Fisher Scientific med hensyn til den feedback, du har givet i denne formular. Vi deler ikke dine oplysninger til andre formål. Alle angivne kontaktoplysninger skal også vedligeholdes i overensstemmelse med vores Privatlivspolitik.
Ser du en mulighed for forbedring?