Learn More
Alfa Aesar™ Calcium L-threonate, 98%
Brand: Alfa Aesar™ J66279.22
Additional Details : CAS Number : 70753-61-6 Weight : 0.10000kg
| Quantity | 100g |
|---|
Description
ApplicationsCalcium L-threonate is reactant involved in synthesis of cyclic hydroxamates and substituted oxazinanones and oxidative degradation to yield oxalate complexes.
Solubility
Soluble in water. Sparingly soluble in methanol.
Notes
Store in cool. Keep container tightly closed in a dry and well-ventilated place. Store away from oxidizing agent.
Chemical Identifiers
| 70753-61-6 | |
| 310.268 | |
| ZJXGOFZGZFVRHK-BALCVSAKSA-L | |
| 13388558 | |
| C(C(C(C(=O)[O-])O)O)O.C(C(C(C(=O)[O-])O)O)O.[Ca+2] |
| C8H14CaO10 | |
| MFCD00077882 | |
| calcium l-threonate, l-threonic acid calcium salt, calcium 2r,3s-2,3,4-trihydroxybutanoate, calcium threonate, unii-hbb4ypo93u, hbb4ypo93u, calcium bis l-threonate, threonine, calcium salt, bis l-threonic acid calcium salt, butanoic acid, 2,3,4-trihydroxy-, calcium salt 2:1 , 2r,3s | |
| calcium;(2R,3S)-2,3,4-trihydroxybutanoate |
Specifications
| Calcium L-threonate | |
| >300°C | |
| 70753-61-6 | |
| MFCD00077882 | |
| Soluble in water. Sparingly soluble in methanol. | |
| C(C(C(C(=O)[O-])O)O)O.C(C(C(C(=O)[O-])O)O)O.[Ca+2] | |
| 310.268 | |
| 310.27 | |
| 98% |
| Brown | |
| 100g | |
| C8H14CaO10 | |
| calcium l-threonate, l-threonic acid calcium salt, calcium 2r,3s-2,3,4-trihydroxybutanoate, calcium threonate, unii-hbb4ypo93u, hbb4ypo93u, calcium bis l-threonate, threonine, calcium salt, bis l-threonic acid calcium salt, butanoic acid, 2,3,4-trihydroxy-, calcium salt 2:1 , 2r,3s | |
| ZJXGOFZGZFVRHK-BALCVSAKSA-L | |
| calcium;(2R,3S)-2,3,4-trihydroxybutanoate | |
| 13388558 | |
| Powder |