Få mere at vide
Bupropion hydrochloride, 99%, Thermo Scientific™
A selective inhibitor of dopamine uptake
Brand: Thermo Scientific Alfa Aesar J61105.03
| Mængde | 1g |
|---|
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsBupropion HC is used as an inhibitor of dopamine and SLC6A2. Bupropion is efficacious as an antidepressant because of its effects on nicotinic receptors, it is also used to promote smoking cessation.
Solubility
Soluble in water (>25 mg/ml), ethanol 193mg/ml, 0.1 N HCl 333 mg/ml
Notes
Store in cool place. Keep container tightly closed in a dry and well-ventilated place. Keep away from strong oxidizing agents.
Kemiske identifikatorer
| 31677-93-7 | |
| 276.201 | |
| HEYVINCGKDONRU-UHFFFAOYSA-N | |
| 62884 | |
| CC(C(=O)C1=CC(=CC=C1)Cl)NC(C)(C)C.Cl |
| C13H19Cl2NO | |
| MFCD00055209 | |
| bupropion hydrochloride, wellbutrin, 2-tert-butylamino-1-3-chlorophenyl propan-1-one hydrochloride, bupropion hcl, zyban, wellbutrin xl, bupropion hydrocloride, wellbutrin sr, budeprion, forfivo xl | |
| 2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-one;hydrochloride |
Tekniske data
| Bupropion hydrochloride | |
| C13H19Cl2NO | |
| 1g | |
| bupropion hydrochloride, wellbutrin, 2-tert-butylamino-1-3-chlorophenyl propan-1-one hydrochloride, bupropion hcl, zyban, wellbutrin xl, bupropion hydrocloride, wellbutrin sr, budeprion, forfivo xl | |
| HEYVINCGKDONRU-UHFFFAOYSA-N | |
| 2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-one;hydrochloride | |
| 62884 | |
| 99% |
| 31677-93-7 | |
| MFCD00055209 | |
| 14,1499 | |
| Soluble in water (>25mg/ml),ethanol 193mg/ml,0.1 N HCl 333mg/ml | |
| CC(C(=O)C1=CC(=CC=C1)Cl)NC(C)(C)C.Cl | |
| 276.201 | |
| 276.2 |
Ved at klikke på Send, anerkender du, at du kan blive kontaktet af Fisher Scientific med hensyn til den feedback, du har givet i denne formular. Vi deler ikke dine oplysninger til andre formål. Alle angivne kontaktoplysninger skal også vedligeholdes i overensstemmelse med vores Privatlivspolitik.