Learn More
Bromothymol Blue, Pure, Conform to ACS, ACROS Organics™
Brand: Acros Organics 403250250
Additional Details : CAS Number : 76-59-5 Weight : 0.07500kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 25g |
Description
IndicatorChemical Identifiers
| 76-59-5 | |
| 624.384 | |
| NUHCTOLBWMJMLX-UHFFFAOYSA-N | |
| 6450 | |
| 2-bromo-4-[3-(3-bromo-4-hydroxy-2-methyl-5-propan-2-ylphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-3-methyl-6-propan-2-ylphenol |
| C27H28Br2O5S | |
| MFCD00005872 | |
| Bromthymol Blue, 3';, 3';';-Dibromothymolsulfonephthalein, BTB | |
| CHEBI:86155 | |
| CC1=C(C(=C(C=C1C2(C3=CC=CC=C3S(=O)(=O)O2)C4=CC(=C(C(=C4C)Br)O)C(C)C)C(C)C)O)Br |
Specifications
| Bromothymol Blue | |
| 76-59-5 | |
| C27H28Br2O5S | |
| 15, 1455 | |
| NUHCTOLBWMJMLX-UHFFFAOYSA-N | |
| CC1=C(C(=C(C=C1C2(C3=CC=CC=C3S(=O)(=O)O2)C4=CC(=C(C(=C4C)Br)O)C(C)C)C(C)C)O)Br | |
| 624.384 | |
| CHEBI:86155 | |
| Crystalline Powder | |
| Glass bottle | |
| from pH 6.0 (yellow) to pH 7.6 (blue) | |
| Brown-Pink to Purple |
| Pure | |
| Passes Test | |
| MFCD00005872 | |
| Bromthymol Blue, 3';, 3';';-Dibromothymolsulfonephthalein, BTB | |
| Authentic | |
| 2-bromo-4-[3-(3-bromo-4-hydroxy-2-methyl-5-propan-2-ylphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-3-methyl-6-propan-2-ylphenol | |
| 6450 | |
| 624.38 | |
| ACS Reagent | |
| Solubility in water: slightly soluble. Other solubilities: soluble in alcohol, alkaline solution | |
| 204.0°C | |
| 25g |