Learn More
![Bis[2-(diphenylphosphino)ethyl]ammonium chloride, 97+%, Alfa Aesar™ 5g Bis[2-(diphenylphosphino)ethyl]ammonium chloride, 97+%, Alfa Aesar™](https://assets.fishersci.com/TFS-Assets/CCG/Chemical-Structures/chemical-structure-cas-66534-97-2.jpg-650.jpg)
![Bis[2-(diphenylphosphino)ethyl]ammonium chloride, 97+%, Alfa Aesar™ 5g Bis[2-(diphenylphosphino)ethyl]ammonium chloride, 97+%, Alfa Aesar™](https://assets.fishersci.com/TFS-Assets/CCG/logos/alfaaesar.jpg-650.jpg)
Bis[2-(diphenylphosphino)ethyl]ammonium chloride, 97+%, Alfa Aesar™
Brand: Alfa Aesar H60250.06
Additional Details : CAS Number : 66534-97-2 Weight : 0.00500kg
| Quantity | 5g |
|---|
Description
ApplicationsIt is involved in the Synthesis of the new chiral aminodiphosphine ligands.
Solubility
Insoluble in water.
Notes
Air Sensitive. Incompatible with oxidizing agents.
Chemical Identifiers
| 66534-97-2 | |
| 477.953 | |
| AVDUVHMGGDOIQI-UHFFFAOYSA-N | |
| 21144848 | |
| C1=CC=C(C=C1)P(CCNCCP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4.Cl |
| C28H30ClNP2 | |
| MFCD00061569 | |
| bis 2-diphenylphosphino ethyl amine hydrochloride, bis 2-diphenylphosphino ethyl ammonium chloride, bis 2-diphenylphosphanyl ethyl amine hydrochloride, ethanamine, 2-diphenylphosphino-n-2-diphenylphosphino ethyl-, hydrochloride, 2-diphenylphosphanyl-n-2-diphenylphosphanyl ethyl ethan-1-amine-hydrogen chloride 1/1 | |
| 2-diphenylphosphanyl-N-(2-diphenylphosphanylethyl)ethanamine;hydrochloride |
Specifications
| Bis[2-(diphenylphosphino)ethyl]ammonium chloride | |
| 175°C to 180°C | |
| 66534-97-2 | |
| [(C6H5)2PCH2CH2]2NH2Cl | |
| bis 2-diphenylphosphino ethyl amine hydrochloride, bis 2-diphenylphosphino ethyl ammonium chloride, bis 2-diphenylphosphanyl ethyl amine hydrochloride, ethanamine, 2-diphenylphosphino-n-2-diphenylphosphino ethyl-, hydrochloride, 2-diphenylphosphanyl-n-2-diphenylphosphanyl ethyl ethan-1-amine-hydrogen chloride 1/1 | |
| AVDUVHMGGDOIQI-UHFFFAOYSA-N | |
| 2-diphenylphosphanyl-N-(2-diphenylphosphanylethyl)ethanamine;hydrochloride | |
| 21144848 | |
| ≥97% |
| Air Sensitive | |
| 5g | |
| C28H30ClNP2 | |
| MFCD00061569 | |
| Insoluble in water. | |
| C1=CC=C(C=C1)P(CCNCCP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4.Cl | |
| 477.953 | |
| 477.95 |