missing translation for 'onlineSavingsMsg'
Få mere at vide
Få mere at vide
Bifonazole, 99%, Thermo Scientific™
Brand: Thermo Scientific Alfa Aesar J63253.03
| Mængde | 1g |
|---|
Denna artikel kan inte returneras.
Se returpolicy
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsBifonazole is an imidazole antifungal agent and calmodulin antagonist. It causes a reduction in glycolysis and ATP levels in B16 melanoma cells. Bifonazole is an inhibitor of C14orf1. Bifonazole is an imidazole-based anti-fungal agent with broad spectrum activity against many fungi, molds, yeast and some gram-positive bacteria. Bifonazole inhibits ergosterol biosynthetic protein 28 and Cytochrome P450 2B4.
Solubility
Soluble in DMSO
Notes
Keep container tightly closed. Store in cool, dry conditions in well sealed containers.
Kemiska identifierare
| 60628-96-8 | |
| 310.4 | |
| OCAPBUJLXMYKEJ-UHFFFAOYSA-N | |
| 2378 | |
| 1-[phenyl-(4-phenylphenyl)methyl]imidazole |
| C22H18N2 | |
| MFCD00865567 | |
| Mycosporan; 1-(alpha,4-Diphenylbenzyl)imidazole | |
| CHEBI:78692 | |
| C1=CC=C(C=C1)C2=CC=C(C=C2)C(C3=CC=CC=C3)N4C=CN=C4 |
Specifikationer
| Bifonazole | |
| White | |
| C22H18N2 | |
| 14,1213 | |
| Soluble in DMSO | |
| C1=CC=C(C=C1)C2=CC=C(C=C2)C(C3=CC=CC=C3)N4C=CN=C4 | |
| 310.4 | |
| CHEBI:78692 | |
| 99% |
| 60628-96-8 | |
| 1g | |
| MFCD00865567 | |
| Mycosporan; 1-(alpha,4-Diphenylbenzyl)imidazole | |
| OCAPBUJLXMYKEJ-UHFFFAOYSA-N | |
| 1-[phenyl-(4-phenylphenyl)methyl]imidazole | |
| 2378 | |
| 310.39 |
Korrigering av produktinnehåll
Din input är viktig för oss. Fyll i det här formuläret för att ge feedback relaterad till innehållet på denna produkt.
Produkttitel
Hittar du en möjlighet till förbättring?Dela en innehållskorrigering