Learn More
Alfa Aesar™ Bestatin hydrochloride, 98%
Brand: Alfa Aesar™ J60384.#0
Additional Details : CAS Number : 65391-42-6 Weight : 0.00005kg
| Quantity | 5mg |
|---|
Description
ApplicationsBestatin is an inhibitor of amino peptidases and a potent, irreversible inhibitor of LTA4 hydrolase. It inhibits the amino peptidase activity of LTA4 hydrolase with a Ki value of 201 nM. It offers promise as a novel analgesic because it protects endogenous opioid peptides against degradation. It does not inhibit carboxypeptidases.
Solubility
Soluble in water (4 mg/ml, warm), DMSO (>25 mg/ml), methanol, acetic acid, dimethyl formamide, and 100% ethanol.
Notes
Store in cool, dry place in a tightly sealed container. Store away from oxidizing agents.
Chemical Identifiers
| 65391-42-6 | |
| 344.836 | |
| XGDFITZJGKUSDK-UDYGKFQRSA-N | |
| 11957481 | |
| CC(C)CC(C(=O)O)NC(=O)C(C(CC1=CC=CC=C1)N)O.Cl |
| C16H25ClN2O4 | |
| MFCD00058004 | |
| bestatin hydrochloride, n-2s,3r-3-amino-2-hydroxy-4-phenylbutyryl-l-leucine hydrochloride, ubenimex hydrochloride, bestatin hcl, bestatin monohydrochloride, c16h24n2o4.hcl, bestatin hydrochloride hplc, bestatin, 2s,3r-3-amino-2-hydroxy-4-phenylbutanoyl-l-leucine hydrochloride | |
| (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoic acid;hydrochloride |
Specifications
| Bestatin hydrochloride | |
| 216°C to 218°C | |
| 65391-42-6 | |
| MFCD00058004 | |
| bestatin hydrochloride, n-2s,3r-3-amino-2-hydroxy-4-phenylbutyryl-l-leucine hydrochloride, ubenimex hydrochloride, bestatin hcl, bestatin monohydrochloride, c16h24n2o4.hcl, bestatin hydrochloride hplc, bestatin, 2s,3r-3-amino-2-hydroxy-4-phenylbutanoyl-l-leucine hydrochloride | |
| XGDFITZJGKUSDK-UDYGKFQRSA-N | |
| (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoic acid;hydrochloride | |
| 11957481 | |
| Powder |
| White | |
| 5mg | |
| C16H25ClN2O4 | |
| 4628066 | |
| Soluble in water (4mg/ml,warm),DMSO (>25mg/ml),methanol,acetic acid,dimethyl formamide,and 100% ethanol. | |
| CC(C)CC(C(=O)O)NC(=O)C(C(CC1=CC=CC=C1)N)O.Cl | |
| 344.836 | |
| 344.87 | |
| 98% |