Learn More
Benzyltrimethylammonium dichloroiodate, 99%, ACROS Organics™
Brand: Acros Organics 268601000
Additional Details : CAS Number : 114971-52-7 Weight : 0.15000kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 100g |
Chemical Identifiers
| 114971-52-7 | |
| 348.04 | |
| PPDJNZTUDFPAHX-UHFFFAOYSA-N | |
| 2724680 |
| C10H16Cl2IN | |
| MFCD00075259 | |
| benzyltrimethylammonium dichloroiodate, benzyltrimethylammonium dichloroiodide, btma-icl2, benzyl trimethylammonium dichloroiodate, benzyltrimethylazanium; dichloroiodanuide, pubchem21920, benzyltrimethylammoniumdichloroiodate | |
| C[N+](C)(C)CC1=CC=CC=C1.Cl[I-]Cl |
Specifications
| Benzyltrimethylammonium dichloroiodate | |
| Glass bottle | |
| 125°C to 128°C | |
| 99% | |
| 98.5 | |
| 99% | |
| C6H5CH2N+(CH3)3Cl2I- | |
| 15,25; 08,434; 13,266; 15,278; 16,289; 17,298; 05,571 | |
| Solubility in water: soluble in water. Other solubilities: soluble in methylene chloride | |
| C[N+](C)(C)CC1=CC=CC=C1.Cl[I-]Cl | |
| 2724680 | |
| Crystalline Powder or Flakes |
| Authentic | |
| Yellow to Brown | |
| 100g | |
| 114971-52-7 | |
| 100.0 | |
| C10H16Cl2IN | |
| MFCD00075259 | |
| benzyltrimethylammonium dichloroiodate, benzyltrimethylammonium dichloroiodide, btma-icl2, benzyl trimethylammonium dichloroiodate, benzyltrimethylazanium; dichloroiodanuide, pubchem21920, benzyltrimethylammoniumdichloroiodate | |
| PPDJNZTUDFPAHX-UHFFFAOYSA-N | |
| 348.04 | |
| 348.04 | |
| 99% |
Safety and Handling
- Benzyltrimethylammonium dichloroiodate
Signal Word
- Warning
Hazard Category
- Serious eye damage/eye irritation Category 2
- Skin corrosion/irritation Category 2
- Specific target organ toxicity Category 3
Hazard Statement
- H319-Causes serious eye irritation.
- H335-May cause respiratory irritation.
- H315-Causes skin irritation.
Precautionary Statement
- P261-Avoid breathing dust/fume/gas/mist/vapours/spray.
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P302+P352-IF ON SKIN: Wash with plenty of water/.
- P305+P351+P338-IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.