Få mere at vide
Benzotropine methanesulfonate, Thermo Scientific™
Muscarinic receptor antagonist
Brand: Thermo Scientific Alfa Aesar J61954.MC
| Mængde | 100mg |
|---|
Se flere versioner af dette produkt
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
SolubilitySoluble in water (81 mg/ml at 25°C), DMSO (50 mg/ml at 25°C), ethanol (81 mg/ml at 25°C), and ether (very slightly).
Notes
Store in cool place. Keep container tightly closed in a dry and well-ventilated place. Store away from oxidizing agents. Store at 4°C.
Kemiske identifikatorer
| 132-17-2 | |
| 403.54 | |
| CPFJLLXFNPCTDW-STYNFMPRSA-N | |
| 3246155 | |
| CS(O)(=O)=O.CN1[C@@H]2CC[C@@H]1CC(C2)OC(C1=CC=CC=C1)C1=CC=CC=C1 |
| C22H29NO4S | |
| MFCD00074784 | |
| benztropine mesylate, cogentin, benztropine mesilate, benztropine methanesulfonate, unii-wmj8tl7510, benztropine methylsulfonate, benzatropine mesilate, benzatropine mesylate, benzotropine mesylate, cobrentin methanesulfonate | |
| (1R,5R)-3-(diphenylmethoxy)-8-methyl-8-azabicyclo[3.2.1]octane; methanesulfonic acid |
Tekniske data
| Benzotropine methanesulfonate | |
| C22H29NO4S | |
| 100mg | |
| 14,1121 | |
| Soluble in water (81mg/ml at 25°C),DMSO (50mg/ml at 25°C),ethanol (81mg/ml at 25°C),and ether (very slightly). | |
| CS(O)(=O)=O.CN1[C@@H]2CC[C@@H]1CC(C2)OC(C1=CC=CC=C1)C1=CC=CC=C1 | |
| 403.54 | |
| 403.54 |
| 132-17-2 | |
| MFCD00074784 | |
| UN2811 | |
| benztropine mesylate, cogentin, benztropine mesilate, benztropine methanesulfonate, unii-wmj8tl7510, benztropine methylsulfonate, benzatropine mesilate, benzatropine mesylate, benzotropine mesylate, cobrentin methanesulfonate | |
| CPFJLLXFNPCTDW-STYNFMPRSA-N | |
| (1R,5R)-3-(diphenylmethoxy)-8-methyl-8-azabicyclo[3.2.1]octane; methanesulfonic acid | |
| 3246155 |
Dit input er vigtigt for os. Udfyld denne formular for at give feedback relateret til indholdet på dette produkt.