Learn More
Benzhydrol, 99%, ACROS Organics™
Brand: Acros Organics 105395000
Additional Details : CAS Number : 91-01-0 Weight : 0.55000kg
| Packaging | Plastic bottle |
|---|---|
| Quantity | 500g |
Chemical Identifiers
| 91-01-0 | |
| 184.24 | |
| QILSFLSDHQAZET-UHFFFAOYSA-N | |
| 7037 | |
| C1=CC=C(C=C1)C(C2=CC=CC=C2)O |
| C13H12O | |
| MFCD00004488 | |
| benzhydrol, diphenylcarbinol, benzohydrol, benzhydryl alcohol, hydroxydiphenylmethane, diphenylmethyl alcohol, diphenyl carbinol, alpha-phenylbenzenemethanol, diphenyl-methanol, benzenemethanol, .alpha.-phenyl | |
| diphenylmethanol |
Specifications
| Benzhydrol | |
| Authentic | |
| Plastic bottle | |
| 297.0°C to 298.0°C | |
| 65.0°C to 68.0°C | |
| 99% | |
| 98.5 | |
| 98.5% min. (GC) | |
| (C6H5)2CHOH | |
| 06, IV, 4648 | |
| benzhydrol, diphenylcarbinol, benzohydrol, benzhydryl alcohol, hydroxydiphenylmethane, diphenylmethyl alcohol, diphenyl carbinol, alpha-phenylbenzenemethanol, diphenyl-methanol, benzenemethanol, .alpha.-phenyl | |
| QILSFLSDHQAZET-UHFFFAOYSA-N | |
| diphenylmethanol | |
| 7037 | |
| Crystalline Solid |
| 160°C | |
| 0.5% max. (55°C) | |
| 0.5% max. (K.F.) | |
| White to Beige | |
| 500g | |
| 91-01-0 | |
| 100.0 | |
| C13H12O | |
| MFCD00004488 | |
| 15, 1092 | |
| Solubility in water: 0.5g/L (20°C) | |
| C1=CC=C(C=C1)C(C2=CC=CC=C2)O | |
| 184.24 | |
| 184.24 | |
| 99% |
Safety and Handling
- Benzhydrol
Signal Word
- Warning
Hazard Category
- Serious eye damage/eye irritation Category 2
- Skin corrosion/irritation Category 2
- Specific target organ toxicity Category 3
Hazard Statement
- H319-Causes serious eye irritation.
- H335-May cause respiratory irritation.
- H315-Causes skin irritation.
Precautionary Statement
- P261-Avoid breathing dust/fume/gas/mist/vapours/spray.
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P302+P352-IF ON SKIN: Wash with plenty of water/.
- P305+P351+P338-IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.