Learn More
Basic Fuchsin, 88%, pure, ACROS Organics™
Brand: Acros Organics 419141000
Additional Details : CAS Number : 632-99-5 Weight : 0.15000kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 100g |
Chemical Identifiers
| 632-99-5 | |
| 337.851 | |
| AXDJCCTWPBKUKL-UHFFFAOYSA-N | |
| 12447 | |
| CC1=CC(=C(C2=CC=C(C=C2)N)C3=CC=C(C=C3)N)C=CC1=N.Cl |
| C20H20ClN3 | |
| MFCD00012569 | |
| Basic Violet 14, hydrochloride, C.I. 42510, Rosaniline chloride | |
| 4-[(4-aminophenyl)-(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]aniline;hydrochloride |
Specifications
| Basic Fuchsin | |
| Typical loss on drying: 10% | |
| 83.0 | |
| 100.0 | |
| 88% | |
| MFCD00012569 | |
| 15, 5715 | |
| Solubility in water: 4g/L (25°C). Other solubilities: soluble in alcohol and acids, practically insoluble in ether, soluble 30g/L in ethanol (25°C) | |
| Authentic | |
| 4-[(4-aminophenyl)-(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]aniline;hydrochloride | |
| 549 to 555nm (in 50:50 IMS:water) | |
| 337.84 | |
| 88% | |
| Glass bottle | |
| 1800 (at lambda min.) | |
| Green | |
| 200°C |
| 88% | |
| 632-99-5 | |
| 1.1 to 1.4 | |
| 83% min. (on dry substance) | |
| C20H20ClN3 | |
| 13, 765 | |
| Basic Violet 14, hydrochloride, C.I. 42510, Rosaniline chloride | |
| AXDJCCTWPBKUKL-UHFFFAOYSA-N | |
| CC1=CC(=C(C2=CC=C(C=C2)N)C3=CC=C(C=C3)N)C=CC1=N.Cl | |
| 337.851 | |
| 12447 | |
| Fine Powder | |
| Pure | |
| Solubility in water: 4g/L (25°C). Other solubilities: soluble in alcohol and acids, practically insoluble in ether, soluble 30g/L in ethanol (25°C) | |
| 250.0°C | |
| 100g |