Få mere at vide
Ammonium dichromate, ACS, 99.5% min, Thermo Scientific™
Catalysts, source of pure nitrogen, in lithography
Brand: Thermo Scientific Alfa Aesar 013444.36
| Mængde | 500g |
|---|
Se flere versioner af dette produkt
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Kemiske identifikatorer
| Cr2H8N2O7 | |
| MFCD00010879 | |
| ammonium dichromate, ammonium bichromate, diammonium dichromate, ammonium dichromate vi, ammoniumbichromaat dutch, ammoniumdichromaat dutch, ammoniumdichromat german, unii-5j18bp595g, hsdb 481 | |
| diazanium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium |
Tekniske data
| Ammonium dichromate | |
| 500g | |
| Cr2H8N2O7 | |
| ammonium dichromate, ammonium bichromate, diammonium dichromate, ammonium dichromate vi, ammoniumbichromaat dutch, ammoniumdichromaat dutch, ammoniumdichromat german, unii-5j18bp595g, hsdb 481 | |
| JOSWYUNQBRPBDN-UHFFFAOYSA-P | |
| diazanium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium | |
| 24600 | |
| ACS Reagent |
| 7789-09-5 | |
| 99.5% | |
| MFCD00010879 | |
| Freely soluble in water.Soluble in water and alcohol. Insoluble in acetone. | |
| [NH4+].[NH4+].[O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-] | |
| 252.06 | |
| 252.1 |
Dit input er vigtigt for os. Udfyld denne formular for at give feedback relateret til indholdet på dette produkt.