Få mere at vide
Aminophylline, anhydrous, 98%, Thermo Scientific™
A non-selective phosphodiesterase inhibitor
Brand: Thermo Scientific Alfa Aesar J60705.14
| Mængde | 25g |
|---|
Se flere versioner af dette produkt
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
SolubilitySoluble in water. Insoluble in alcohol and ether.
Notes
Store in cool place. Keep container tightly closed in a dry and well-ventilated place. Recommended storage temperature: -20°C. Keep away fom strong oxidizing agents.
Kemiske identifikatorer
| 317-34-0 | |
| 420.434 | |
| FQPFAHBPWDRTLU-UHFFFAOYSA-N | |
| 9433 | |
| CN1C2=C(C(=O)N(C1=O)C)NC=N2.CN1C2=C(C(=O)N(C1=O)C)NC=N2.C(CN)N |
| C16H24N10O4 | |
| MFCD00013221 | |
| aminophylline, aminophyllin, theophyllamine, cardophyllin, phyllocontin, somophyllin, truphylline, theophylline ethylenediamine, cardiofilina, ethophylline | |
| 1,3-dimethyl-7H-purine-2,6-dione;ethane-1,2-diamine |
Tekniske data
| Aminophylline | |
| 317-34-0 | |
| MFCD00013221 | |
| UN2811 | |
| aminophylline, aminophyllin, theophyllamine, cardophyllin, phyllocontin, somophyllin, truphylline, theophylline ethylenediamine, cardiofilina, ethophylline | |
| FQPFAHBPWDRTLU-UHFFFAOYSA-N | |
| 1,3-dimethyl-7H-purine-2,6-dione;ethane-1,2-diamine | |
| 9433 | |
| 98% |
| anhydrous | |
| C16H24N10O4 | |
| 25g | |
| 14,465 | |
| Soluble in water. Insoluble in alcohol and ether. | |
| CN1C2=C(C(=O)N(C1=O)C)NC=N2.CN1C2=C(C(=O)N(C1=O)C)NC=N2.C(CN)N | |
| 420.434 | |
| 210.21 |
Ved at klikke på Send, anerkender du, at du kan blive kontaktet af Fisher Scientific med hensyn til den feedback, du har givet i denne formular. Vi deler ikke dine oplysninger til andre formål. Alle angivne kontaktoplysninger skal også vedligeholdes i overensstemmelse med vores Privatlivspolitik.