Learn More
Adenosine 5'-diphosphate, disodium salt hydrate, 98%, ACROS Organics™
Brand: Acros Organics 164672500
Additional Details : CAS Number : 16178-48-6 Weight : 0.05025kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 250mg |
Chemical Identifiers
| 16178-48-6 | |
| 471.16 | |
| ORKSTPSQHZNDSC-IDIVVRGQSA-L | |
| 85315 | |
| C1=NC2=C(C(=N1)N)N=CN2C3C(C(C(O3)COP(=O)([O-])OP(=O)(O)[O-])O)O.[Na+].[Na+] |
| C10H13N5Na2O10P2·xH2O | |
| MFCD00150927 | |
| adenosine 5'-diphosphate disodium salt, adenosine-5'-diphosphate disodium salt, sodium 2r,3s,4r,5r-5-6-amino-9h-purin-9-yl-3,4-dihydroxytetrahydrofuran-2-yl methyl hydrogendiphosphate, adenosine 5'-diphosphate disodium salt hydrate, adenosine, 5'-diphosphoric acid, disodium salt, adenosine 5'-trihydrogen diphosphate , disodium salt, trinosin s hydrate, disodium hydrogen 2r,3s,4r,5r-5-6-aminopurin-9-yl-3,4-dihydroxyoxolan-2-yl methyl phosphonato oxyphosphonate, adenosine 5'-trihydrogen diphosphate , sodium salt 1:2, disodium adp hydrate | |
| disodium;[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] hydrogen phosphate |
Specifications
| 0.76 to 0.80 (A250/A260), 0.15 to 0.17 (A280/A260) | |
| Adenosine 5′-diphosphate, disodium salt hydrate | |
| Glass bottle | |
| 10% max. (K.F.) | |
| 250mg | |
| 97.5 | |
| 98% | |
| MFCD00150927 | |
| (5% w/v in water) Clear colorless | |
| C1=NC2=C(C(=N1)N)N=CN2C3C(C(C(O3)COP(=O)([O-])OP(=O)(O)[O-])O)O.[Na+].[Na+] | |
| 471.16 | |
| 471.16 | |
| 98% |
| (5% w/v aq. soln.) clear, colorless | |
| Authentic | |
| 97.5 to 102.5% (ADP-Na2H,on dry basis) (calculated) 82% min. (ADP,on as is basis) (lambda max. 260nm) molar absorptivity 15000+/-2%,pH 7 | |
| White | |
| 16178-48-6 | |
| 100.0 | |
| C10H13N5Na2O10P2·xH2O | |
| adenosine 5'-diphosphate disodium salt, adenosine-5'-diphosphate disodium salt, sodium 2r,3s,4r,5r-5-6-amino-9h-purin-9-yl-3,4-dihydroxytetrahydrofuran-2-yl methyl hydrogendiphosphate, adenosine 5'-diphosphate disodium salt hydrate, adenosine, 5'-diphosphoric acid, disodium salt, adenosine 5'-trihydrogen diphosphate , disodium salt, trinosin s hydrate, disodium hydrogen 2r,3s,4r,5r-5-6-aminopurin-9-yl-3,4-dihydroxyoxolan-2-yl methyl phosphonato oxyphosphonate, adenosine 5'-trihydrogen diphosphate , sodium salt 1:2, disodium adp hydrate | |
| ORKSTPSQHZNDSC-IDIVVRGQSA-L | |
| disodium;[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] hydrogen phosphate | |
| 85315 | |
| Powder |