Få mere at vide
Ketanserin tartrate, 98+%, Thermo Scientific™
Selective 5-HT2A serotonin receptor antagonist
Brand: Thermo Scientific Alfa Aesar J62798.MD
| Mængde | 250mg |
|---|
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Tekniske data
| Ketanserin tartrate | |
| C26H30FN3O10 | |
| 250mg | |
| 14,5296 | |
| Soluble in DMSO at 50mg/ml; Also soluble in 0;1N HCl (6mg/ml) or in ethanol (3;3mg/ml) | |
| O.OC(C(O)C(O)=O)C(O)=O.FC1=CC=C(C=C1)C(=O)C1CCN(CCN2C(=O)NC3=CC=CC=C3C2=O)CC1 | |
| 563.54 | |
| 545.52 |
| 83846-83-7 | |
| MFCD00084651,MFCD11864992,MFCD00083392 | |
| UN2811 | |
| ketanserin tartrate | |
| KJJRKCWDAHTVRL-UHFFFAOYNA-N | |
| 2,3-dihydroxybutanedioic acid 3-{2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl}-1,2,3,4-tetrahydroquinazoline-2,4-dione hydrate | |
| 91885469 | |
| ≥98% |
Dit input er vigtigt for os. Udfyld denne formular for at give feedback relateret til indholdet på dette produkt.