Learn More
Alfa Aesar™ 5-Bromo-2'-deoxyuridine, 99%
Brand: Alfa Aesar™ H27260.MD
Additional Details : CAS Number : 59-14-3 Weight : 0.00025kg
| Quantity | 250mg |
|---|
Description
Applications5-Bromo-2′-deoxyuridine (BrdU) is a thymidine analog used to label DNA. It is incorporated into newly synthesized DNA in place of thymidine during the S phase of the cell cycle. Cells that were actively proliferating can then be detected by denaturing the DNA and allowing specific antibodies to target the BrdU incorporation. Consequently 5-BrdU is used to study cell signaling and other processes that induce cell proliferation.
Solubility
Soluble in water.
Notes
Store in cool place. Keep container tightly closed in a dry and well-ventilated place. Store away from strong oxidizing agents.
Chemical Identifiers
| 59-14-3 | |
| 307.1 | |
| WOVKYSAHUYNSMH-RRKCRQDMSA-N | |
| 6035 | |
| 5-bromo-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| C9H11BrN2O5 | |
| MFCD00006529 | |
| 5-bromo-2'-deoxyuridine, broxuridine, bromodeoxyuridine, brdu, 5-bromodeoxyuridine, 5-brdu, budr, 5-bromouracil deoxyriboside, bromouracil deoxyriboside, 5-bromodesoxyuridine | |
| CHEBI:472552 | |
| C1C(C(OC1N2C=C(C(=O)NC2=O)Br)CO)O |
Specifications
| 5-Bromo-2'-deoxyuridine | |
| ∽190°C (decomposition) | |
| 59-14-3 | |
| MFCD00006529 | |
| 14,1452 | |
| Soluble in water. | |
| C1C(C(OC1N2C=C(C(=O)NC2=O)Br)CO)O | |
| 307.1 | |
| CHEBI:472552 | |
| 99% |
| +31° (c=1 in 0.1N HCl) | |
| 250mg | |
| C9H11BrN2O5 | |
| 30395 | |
| 5-bromo-2'-deoxyuridine, broxuridine, bromodeoxyuridine, brdu, 5-bromodeoxyuridine, 5-brdu, budr, 5-bromouracil deoxyriboside, bromouracil deoxyriboside, 5-bromodesoxyuridine | |
| WOVKYSAHUYNSMH-RRKCRQDMSA-N | |
| 5-bromo-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione | |
| 6035 | |
| 307.1 |