Learn More
4-Nitroquinoline-N-oxide, 98%, ACROS Organics™
Brand: Acros Organics 203792500
Additional Details : CAS Number : 56-57-5 Weight : 0.05025kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 250mg |
Chemical Identifiers
| 56-57-5 | |
| 190.158 | |
| YHQDZJICGQWFHK-UHFFFAOYSA-N | |
| CHEBI:16907 |
| C9H6N2O3 | |
| MFCD00006738 | |
| 5955 |
Specifications
| 4-Nitroquinoline-N-oxide | |
| 97.5 | |
| Authentic | |
| ≥97.5% | |
| 98% | |
| C9H6N2O3 | |
| YHQDZJICGQWFHK-UHFFFAOYSA-N | |
| 4-nitro-1-oxidoquinolin-1-ium | |
| 5955 | |
| 190.16 |
| 56-57-5 | |
| 100.0 | |
| Glass bottle | |
| Brown to Ochre-Yellow | |
| 250mg | |
| MFCD00006738 | |
| C1=CC=C2C(=C1)C(=CC=[N+]2[O-])[N+](=O)[O-] | |
| 190.158 | |
| CHEBI:16907 | |
| Crystalline Solid |
Safety and Handling
- 4-Nitroquinoline-N-oxide
Signal Word
- Danger
Hazard Category
- Carcinogenicity Category 1B
Hazard Statement
- H350-May cause cancer.
Precautionary Statement
- P201-Obtain special instructions before use.
- P202-Do not handle until all safety precautions have been read and understood.
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P308+P313-IF exposed or concerned: Get medical advice/attention.