Learn More
Alfa Aesar™ 4-Nitrophenyl acetate, 98+%
Brand: Alfa Aesar™ L00314.18
Additional Details : CAS Number : 830-03-5 Weight : 0.05000kg
| Quantity | 50g |
|---|
Description
Applications4-Nitrophenyl acetate is used with iodoacetic acid for reductive cleavage of methionine-containing peptides. It is also used as a substrate that has been used in assays for esterase and lipase activity. Inorganic complexes have been evaluated for their methanolysis or hydrolysis activity using p-nitrophenyl acetate.
Solubility
Insoluble in water.
Notes
Store away from strong oxidizing agents. Keep container tightly closed. Store in cool, dry conditions in well sealed containers.
Chemical Identifiers
| 830-03-5 | |
| 181.147 | |
| QAUUDNIGJSLPSX-UHFFFAOYSA-N | |
| 13243 | |
| (4-nitrophenyl) acetate |
| C8H7NO4 | |
| MFCD00007326 | |
| p-nitrophenyl acetate, p-acetoxynitrobenzene, acetic acid, 4-nitrophenyl ester, p-nitrophenol acetate, acetic acid p-nitrophenyl ester, acetic acid, p-nitrophenyl ester, p-nitrophenyl acetate van, 4-nitrophenyl acetate, unii-i902j0qh9s, acetic acid 4-nitrophenyl ester | |
| CHEBI:82635 | |
| CC(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Specifications
| 4-Nitrophenyl acetate | |
| 50g | |
| C8H7NO4 | |
| 515874 | |
| Insoluble in water. | |
| CC(=O)OC1=CC=C(C=C1)[N+](=O)[O-] | |
| 181.147 | |
| CHEBI:82635 | |
| ≥98% |
| 77°C to 79°C | |
| 830-03-5 | |
| MFCD00007326 | |
| p-nitrophenyl acetate, p-acetoxynitrobenzene, acetic acid, 4-nitrophenyl ester, p-nitrophenol acetate, acetic acid p-nitrophenyl ester, acetic acid, p-nitrophenyl ester, p-nitrophenyl acetate van, 4-nitrophenyl acetate, unii-i902j0qh9s, acetic acid 4-nitrophenyl ester | |
| QAUUDNIGJSLPSX-UHFFFAOYSA-N | |
| (4-nitrophenyl) acetate | |
| 13243 | |
| 181.15 |