Learn More
4-Methyl-3-nitrobenzoic acid, 99%, ACROS Organics™
Brand: Acros Organics 165991000
Additional Details : CAS Number : 96-98-0 Weight : 0.26000kg
Packaging | Glass bottle |
---|---|
Quantity | 100g |
Chemical Identifiers
96-98-0 | |
181.15 | |
BBEWSMNRCUXQRF-UHFFFAOYSA-N | |
7319 |
C8H7NO4 | |
MFCD00007174 | |
4-methyl-3-nitrobenzoic acid, 3-nitro-4-methylbenzoic acid, 3-nitro-p-toluic acid, benzoic acid, 4-methyl-3-nitro, 3-nitro-para-toluic acid, m-nitro-p-toluic acid, 4-methyl-3-nitro-benzoic acid, p-toluic acid, 3-nitro, 3-nitro-4-methyl benzoic acid, benzoic acid,4-methyl-3-nitro | |
CC1=C(C=C(C=C1)C(=O)O)[N+](=O)[O-] |
Specifications
4-Methyl-3-nitrobenzoic acid | |
Glass bottle | |
187.0°C to 190.0°C | |
99% | |
98.5 | |
99% | |
CH3C6H3(NO2)CO2H | |
09, 502 | |
Solubility in water: slightly soluble. Other solubilities: soluble in alcohols | |
CC1=C(C=C(C=C1)C(=O)O)[N+](=O)[O-] | |
7319 | |
Crystalline Powder |
Authentic | |
White to Yellow | |
100g | |
96-98-0 | |
100.0 | |
C8H7NO4 | |
MFCD00007174 | |
4-methyl-3-nitrobenzoic acid, 3-nitro-4-methylbenzoic acid, 3-nitro-p-toluic acid, benzoic acid, 4-methyl-3-nitro, 3-nitro-para-toluic acid, m-nitro-p-toluic acid, 4-methyl-3-nitro-benzoic acid, p-toluic acid, 3-nitro, 3-nitro-4-methyl benzoic acid, benzoic acid,4-methyl-3-nitro | |
BBEWSMNRCUXQRF-UHFFFAOYSA-N | |
181.15 | |
181.15 | |
99% |