Learn More
Alfa Aesar™ 4-Hydroxy-2,3,5,6-tetrafluorobenzoic acid, 97%
Brand: Alfa Aesar™ L20209.14
Additional Details : CAS Number : 652-34-6 Weight : 0.02500kg
| Quantity | 25g |
|---|
Description
Applications2,3,5,6-Tetrafluoro-4-hydroxybenzoic acid hydrate may be used in the preparation of new ligand, methyl 2,3,5,6-tetrafluoro-4-oxybenzoate (C8H3F4O3), combining an electron withdrawing group (C6F4) to tune the reactivity with an anchor group (CO2Me) for immobilization on supports.
Solubility
Insoluble in water.
Notes
Store away from oxidizing agents. Keep the container tightly closed and place it in a cool, dry and well ventilated condition.
Chemical Identifiers
| 652-34-6 | |
| 210.084 | |
| FTLHGQOBAPTEHE-UHFFFAOYSA-N | |
| 98835 | |
| C1(=C(C(=C(C(=C1F)F)O)F)F)C(=O)O |
| C7H2F4O3 | |
| MFCD00129952 | |
| 4-hydroxy-2,3,5,6-tetrafluorobenzoic acid, 2,3,5,6-tetrafluoro-4-hydroxy-benzoic acid, tetrafluoro-4-hydroxybenzoic acid, benzoic acid, 2,3,5,6-tetrafluoro-4-hydroxy, f4-pohb, tetrafluoro-4-hydroxybenzoate, zlchem 412, acmc-1b1y5, ksc622i2b, 4-carboxy-2,3,5,6-tetrafluorophenol | |
| 2,3,5,6-tetrafluoro-4-hydroxybenzoic acid |
Specifications
| 4-Hydroxy-2,3,5,6-tetrafluorobenzoic acid | |
| 25g | |
| C7H2F4O3 | |
| 986011 | |
| Insoluble in water. | |
| C1(=C(C(=C(C(=C1F)F)O)F)F)C(=O)O | |
| 210.084 | |
| 210.1 |
| 148°C to 150°C (decomposition) | |
| 652-34-6 | |
| MFCD00129952 | |
| 4-hydroxy-2,3,5,6-tetrafluorobenzoic acid, 2,3,5,6-tetrafluoro-4-hydroxy-benzoic acid, tetrafluoro-4-hydroxybenzoic acid, benzoic acid, 2,3,5,6-tetrafluoro-4-hydroxy, f4-pohb, tetrafluoro-4-hydroxybenzoate, zlchem 412, acmc-1b1y5, ksc622i2b, 4-carboxy-2,3,5,6-tetrafluorophenol | |
| FTLHGQOBAPTEHE-UHFFFAOYSA-N | |
| 2,3,5,6-tetrafluoro-4-hydroxybenzoic acid | |
| 98835 | |
| 97% |