Learn More
4-chloroquinoline, 99%, ACROS Organics™
Brand: Acros Organics 110050010
Additional Details : CAS Number : 611-35-8 Weight : 0.05100kg
| Quantity | 1g |
|---|
Chemical Identifiers
| 611-35-8 | |
| 163.61 | |
| KNDOFJFSHZCKGT-UHFFFAOYSA-N | |
| 69140 | |
| C1=CC=C2C(=C1)C(=CC=N2)Cl |
| C9H6ClN | |
| MFCD00006773 | |
| quinoline, 4-chloro, 4-chloro-quinoline, ccris 3979, 4-chioroquinoline, acmc-209mpi, 4-chloroquinoline, ksc354e5n, 4-chloroquinoline 1g, kndofjfshzckgt-uhfffaoysa | |
| 4-chloroquinoline |
Specifications
| 4-chloroquinoline | |
| 110°C | |
| 1.25 | |
| 29.0°C to 32.0°C | |
| 611-35-8 | |
| 100.0 | |
| C9H6ClN | |
| 20,36 | |
| KNDOFJFSHZCKGT-UHFFFAOYSA-N | |
| 4-chloroquinoline | |
| 69140 | |
| 99% |
| 1.2500g/mL | |
| Glass bottle | |
| 260.0°C to 261.0°C | |
| 1g | |
| 98.5 | |
| 98.5% min. (GC) | |
| MFCD00006773 | |
| quinoline, 4-chloro, 4-chloro-quinoline, ccris 3979, 4-chioroquinoline, acmc-209mpi, 4-chloroquinoline, ksc354e5n, 4-chloroquinoline 1g, kndofjfshzckgt-uhfffaoysa | |
| C1=CC=C2C(=C1)C(=CC=N2)Cl | |
| 163.61 | |
| 163.61 |
Safety and Handling
- 4-Chloroquinoline
Signal Word
- Warning
Hazard Category
- Serious eye damage/eye irritation Category 2
- Skin corrosion/irritation Category 2
- Specific target organ toxicity Category 3
Hazard Statement
- H319-Causes serious eye irritation.
- H335-May cause respiratory irritation.
- H315-Causes skin irritation.
Precautionary Statement
- P261-Avoid breathing dust/fume/gas/mist/vapours/spray.
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P302+P352-IF ON SKIN: Wash with plenty of water/.
- P305+P351+P338-IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.