missing translation for 'onlineSavingsMsg'
Få mere at vide
Få mere at vide
4,5',8-Trimethylpsoralen, 99%, Thermo Scientific™
Brand: Thermo Scientific Alfa Aesar J63226.03
| Mængde | 1g |
|---|
Denne vare kan ikke returneres.
Se returpolitik
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Applications4,5′,8-Trimethylpsoralen is used for treatment of psoriasis, and as a photochemical crosslinker of DNA used as a probe for nucleic acid structure, used to crosslink DNA onto mica surfaces, mutagenesis of N2 worms.
Solubility
Soluble in chloroform
Notes
Keep container tightly closed. Store away from oxidizing agents. Store in cool, dry conditions in well sealed containers.
Kemiske identifikatorer
| C14H12O3 | |
| MFCD00005010 | |
| trioxsalen, trioxysalen, trisoralen, trimethylpsoralen, 4,5',8-trimethylpsoralen, elder 8011, trioxisaleno, trioxysalene, trioxysalenum, 2',4,8-trimethylpsoralen | |
| CHEBI:28329 | |
| CC1=CC2=CC3=C(OC(=O)C=C3C)C(C)=C2O1 |
Tekniske data
| 4,5',8-Trimethylpsoralen | |
| C14H12O3 | |
| 1g | |
| 221723 | |
| trioxsalen, trioxysalen, trisoralen, trimethylpsoralen, 4,5',8-trimethylpsoralen, elder 8011, trioxisaleno, trioxysalene, trioxysalenum, 2',4,8-trimethylpsoralen | |
| FMHHVULEAZTJMA-UHFFFAOYSA-N | |
| 2,5,9-trimethyl-7H-furo[3,2-g]chromen-7-one | |
| 5585 | |
| 228.25 |
| 3902-71-4 | |
| MFCD00005010 | |
| UN1759 | |
| 14,9735 | |
| Soluble in chloroform | |
| CC1=CC2=CC3=C(OC(=O)C=C3C)C(C)=C2O1 | |
| 228.25 | |
| CHEBI:28329 | |
| 99% |
Korrektion af produktindhold
Dit input er vigtigt for os. Udfyld denne formular for at give feedback relateret til indholdet på dette produkt.
Produkttitel
Ser du en mulighed for forbedring?Del en indholdskorrektion