Learn More
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 97%, ACROS Organics™
Brand: Acros Organics 366390010
Additional Details : CAS Number : 180516-87-4 Weight : 0.05100kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 1g |
Chemical Identifiers
| 180516-87-4 | |
| 248.09 | |
| IYDKBQIEOBXLTP-UHFFFAOYSA-N | |
| 2734621 | |
| B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)O |
| C13H17BO4 | |
| MFCD01863710 | |
| 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoic acid, 4-carboxyphenylboronic acid pinacol ester, 4-carboxylphenylboronic acid pinacol ester, 4-carboxyphenylboronic acid, pinacol ester, 4-carboxyphenylboronicacidpinacolester, 4-carboxybenzeneboronic acid pinacol ester, 4-carboxyphenylboronic acid pinacolate, 4-tetramethyl-1,3,2-dioxaborolan-2-yl benzoic acid, 4-carboxyphenylboronic acid,pinacol ester, 4-carboxyphenyl boronic acid, pinacol ester | |
| 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
Specifications
| 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid | |
| Glass bottle | |
| 227.0°C to 232.0°C | |
| 97% | |
| 96.0 | |
| 97% | |
| MFCD01863710 | |
| Solubility in water: insoluble. | |
| B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)O | |
| 248.09 | |
| 248.09 | |
| 97% |
| Authentic | |
| White | |
| 1g | |
| 180516-87-4 | |
| 100.0 | |
| C13H17BO4 | |
| 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoic acid, 4-carboxyphenylboronic acid pinacol ester, 4-carboxylphenylboronic acid pinacol ester, 4-carboxyphenylboronic acid, pinacol ester, 4-carboxyphenylboronicacidpinacolester, 4-carboxybenzeneboronic acid pinacol ester, 4-carboxyphenylboronic acid pinacolate, 4-tetramethyl-1,3,2-dioxaborolan-2-yl benzoic acid, 4-carboxyphenylboronic acid,pinacol ester, 4-carboxyphenyl boronic acid, pinacol ester | |
| IYDKBQIEOBXLTP-UHFFFAOYSA-N | |
| 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid | |
| 2734621 | |
| Crystalline Powder |
Safety and Handling
- 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid
Signal Word
- Warning
Hazard Category
- Serious eye damage/eye irritation Category 2
- Skin corrosion/irritation Category 2
- Specific target organ toxicity Category 3
Hazard Statement
- H319-Causes serious eye irritation.
- H335-May cause respiratory irritation.
- H315-Causes skin irritation.
Precautionary Statement
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P305+P351+P338-IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.