Learn More
3-Nitrobenzamide, 98%, ACROS Organics™
Brand: Acros Organics 183441000
Additional Details : CAS Number : 645-09-0 Weight : 0.15000kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 100g |
Chemical Identifiers
| 645-09-0 | |
| 166.14 | |
| KWAYEPXDGHYGRW-UHFFFAOYSA-N | |
| 12576 | |
| C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)N |
| C7H6N2O3 | |
| MFCD00007984 | |
| m-nitrobenzamide, benzamide, 3-nitro, benzamide, m-nitro, 3-nitro-benzamide, 3-nitrophenylcarboxamide, acmc-209nmr, 3-nitrobenzamide, dsstox_cid_5732, dsstox_rid_77897, dsstox_gsid_25732 | |
| 3-nitrobenzamide |
Specifications
| 3-Nitrobenzamide | |
| Glass bottle | |
| 140°C to 144°C | |
| 98% | |
| 97.5 | |
| 97.5% min. (HPLC) | |
| O2NC6H4CONH2 | |
| 09, 381 | |
| Solubility in water: slightly soluble | |
| C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)N | |
| 166.14 | |
| 166.14 | |
| 98% |
| Authentic | |
| Yellow | |
| 100g | |
| 645-09-0 | |
| 100.0 | |
| C7H6N2O3 | |
| MFCD00007984 | |
| m-nitrobenzamide, benzamide, 3-nitro, benzamide, m-nitro, 3-nitro-benzamide, 3-nitrophenylcarboxamide, acmc-209nmr, 3-nitrobenzamide, dsstox_cid_5732, dsstox_rid_77897, dsstox_gsid_25732 | |
| KWAYEPXDGHYGRW-UHFFFAOYSA-N | |
| 3-nitrobenzamide | |
| 12576 | |
| Crystalline Powder or Crystals |
Safety and Handling
- 3-Nitrobenzamide
Signal Word
- Warning
Hazard Category
- Acute toxicity Category 4
- Serious eye damage/eye irritation Category 2
- Skin corrosion/irritation Category 2
- Specific target organ toxicity Category 3
Hazard Statement
- H315-Causes skin irritation.
- H319-Causes serious eye irritation.
- H335-May cause respiratory irritation.
- H302-Harmful if swallowed.
Precautionary Statement
- P261-Avoid breathing dust/fume/gas/mist/vapours/spray.
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P301+P312-IF SWALLOWED: Call a POISON CENTER or doctor/physician/ if you feel unwell.
- P302+P352-IF ON SKIN: Wash with plenty of water/.
- P305+P351+P338-IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.