missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Alfa Aesar™ 3-Fluoro-4-(4-methyl-1-piperazinyl)benzeneboronic acid pinacol ester, 95%
Brand: Alfa Aesar™ H59640.03
Additional Details : Weight : 0.00100kg
| Quantity | 1g |
|---|
Description
NotesStore away from oxidizing agents. Keep the container tightly closed and place it in a cool, dry and well ventilated condition.
Chemical Identifiers
| 1408088-34-5 | |
| 320.215 | |
| RFECQDXNBWGCRR-UHFFFAOYSA-N | |
| 70974710 | |
| B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)N3CCN(CC3)C)F |
| C17H26BFN2O2 | |
| MFCD22988988 | |
| 1-2-fluoro-4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl phenyl-4-methylpiperazine, 3-fluoro-4-4-methyl-1-piperazinyl benzeneboronic acid pinacol ester | |
| 1-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-methylpiperazine |
Specifications
| 3-Fluoro-4-(4-methyl-1-piperazinyl)benzeneboronic acid pinacol ester | |
| 1408088-34-5 | |
| MFCD22988988 | |
| RFECQDXNBWGCRR-UHFFFAOYSA-N | |
| 1-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-methylpiperazine | |
| 70974710 | |
| 95% |
| 1g | |
| C17H26BFN2O2 | |
| 1-2-fluoro-4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl phenyl-4-methylpiperazine, 3-fluoro-4-4-methyl-1-piperazinyl benzeneboronic acid pinacol ester | |
| B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)N3CCN(CC3)C)F | |
| 320.215 | |
| 320.21 |