Learn More
3-Aminophenylboronic acid hemisulfate, 98%, ACROS Organics™
Brand: Acros Organics 104300010
Additional Details : CAS Number : 66472-86-4 Weight : 0.05100kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 1g |
Chemical Identifiers
| 66472-86-4 | |
| 185.99 | |
| UKTAURVTSWDIQR-UHFFFAOYSA-N | |
| 16211139 | |
| B(C1=CC(=CC=C1)N)(O)O.B(C1=CC(=CC=C1)N)(O)O.OS(=O)(=O)O |
| 0·5 H2O4S | |
| MFCD00013111 | |
| 3-aminophenyl boronic acid sulfate 2:1, 3-aminobenzeneboronic acid hemisulfate salt, 3-aminophenylboronic acid hemisulfate, 3-aminobenzeneboronic acid hemisulfate, 3-aminophenylboronic acid hemisulphate, 4-aminophenylboronic acid hemisulfate, m-aminophenyl boronic acid, hemisulphate, boronic acid, 3-aminophenyl-, sulfate 2:1, 3-aminophenyl boronic acid; sulfuric acid, bis m-aminophenylboronic acid ; sulfuric acid | |
| (3-aminophenyl)boronic acid;sulfuric acid |
Specifications
| 3-Aminophenylboronic acid hemisulfate | |
| Glass bottle | |
| 1g | |
| 97.5 | |
| 98% | |
| H2NC6H4B(OH)2·1/2H2SO4 | |
| 3-aminophenyl boronic acid sulfate 2:1, 3-aminobenzeneboronic acid hemisulfate salt, 3-aminophenylboronic acid hemisulfate, 3-aminobenzeneboronic acid hemisulfate, 3-aminophenylboronic acid hemisulphate, 4-aminophenylboronic acid hemisulfate, m-aminophenyl boronic acid, hemisulphate, boronic acid, 3-aminophenyl-, sulfate 2:1, 3-aminophenyl boronic acid; sulfuric acid, bis m-aminophenylboronic acid ; sulfuric acid | |
| B(C1=CC(=CC=C1)N)(O)O.B(C1=CC(=CC=C1)N)(O)O.OS(=O)(=O)O | |
| 185.99 | |
| 185.99 | |
| 98% |
| Authentic | |
| White to Beige | |
| 66472-86-4 | |
| 100.0 | |
| 0·5 H2O4S | |
| MFCD00013111 | |
| UKTAURVTSWDIQR-UHFFFAOYSA-N | |
| (3-aminophenyl)boronic acid;sulfuric acid | |
| 16211139 | |
| Crystalline Powder |
Safety and Handling
- 3-Aminophenylboronic acid hemisulfate
Signal Word
- Warning
Hazard Category
- Serious eye damage/eye irritation Category 2
- Skin corrosion/irritation Category 2
- Specific target organ toxicity Category 3
Hazard Statement
- H319-Causes serious eye irritation.
- H335-May cause respiratory irritation.
- H315-Causes skin irritation.
Precautionary Statement
- P261-Avoid breathing dust/fume/gas/mist/vapours/spray.
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P302+P352-IF ON SKIN: Wash with plenty of water/.
- P305+P351+P338-IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.