Learn More
2-(Diphenylphosphino)ethyltriethoxysilane, 92%, ACROS Organics™
Brand: Acros Organics 391860050
Additional Details : CAS Number : 18586-39-5 Weight : 0.05500kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 5g |
Description
for C-C Bond Formation (Olefination)Chemical Identifiers
| 18586-39-5 | |
| 376.51 | |
| HLXCYTXLQJWQFG-UHFFFAOYSA-N | |
| 87708 | |
| CCO[Si](CCP(C1=CC=CC=C1)C2=CC=CC=C2)(OCC)OCC |
| C20H29O3PSi | |
| MFCD00015125 | |
| 2-diphenylphosphino ethyltriethoxysilane, diphenyl 2-triethoxysilyl ethyl phosphine, phosphine, diphenyl 2-triethoxysilyl ethyl, diphenyl 2-triethoxysilyl ethyl phosphane, phosphine,diphenyl 2-triethoxysilyl ethyl, triethoxysilyl ethyl diphenylphosphine, ksc268s0d | |
| diphenyl(2-triethoxysilylethyl)phosphane |
Specifications
| 2-(Diphenylphosphino)ethyltriethoxysilane | |
| 134.5°C | |
| Glass bottle | |
| 1.05 | |
| Colorless to Yellow | |
| 18586-39-5 | |
| 100.0 | |
| C20H29O3PSi | |
| 2-diphenylphosphino ethyltriethoxysilane, diphenyl 2-triethoxysilyl ethyl phosphine, phosphine, diphenyl 2-triethoxysilyl ethyl, diphenyl 2-triethoxysilyl ethyl phosphane, phosphine,diphenyl 2-triethoxysilyl ethyl, triethoxysilyl ethyl diphenylphosphine, ksc268s0d | |
| HLXCYTXLQJWQFG-UHFFFAOYSA-N | |
| diphenyl(2-triethoxysilylethyl)phosphane | |
| 87708 | |
| Liquid |
| 1.0500g/mL | |
| Authentic | |
| 1.5390 to 1.5410 (20°C, 589nm) | |
| 182.0°C (1.3 mmHg) | |
| 5g | |
| 90.0 | |
| 90% min. (GC) | |
| MFCD00015125 | |
| Solubility in water: reacts. | |
| CCO[Si](CCP(C1=CC=CC=C1)C2=CC=CC=C2)(OCC)OCC | |
| 376.51 | |
| 376.51 | |
| 92% |
Safety and Handling
- 2-(Diphenylphosphino)ethyltriethoxysilane
Signal Word
- Warning
Hazard Category
- Acute toxicity Category 4
- Serious eye damage/eye irritation Category 2
- Skin corrosion/irritation Category 2
- Specific target organ toxicity Category 3
Hazard Statement
- H315-Causes skin irritation.
- H319-Causes serious eye irritation.
- H335-May cause respiratory irritation.
- H302-Harmful if swallowed.
Precautionary Statement
- P261-Avoid breathing dust/fume/gas/mist/vapours/spray.
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P301+P312-IF SWALLOWED: Call a POISON CENTER or doctor/physician/ if you feel unwell.
- P302+P352-IF ON SKIN: Wash with plenty of water/.
- P305+P351+P338-IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.