Learn More
Alfa Aesar™ 2-Chloro-4-(trifluoromethyl)benzenesulfonyl chloride, 97%
Brand: Alfa Aesar™ L19105.06
Additional Details : CAS Number : 175205-54-6 Weight : 0.00500kg Transport : UN number : 3261 Chem class : 8 Pack group : II
| Quantity | 5g |
|---|
Chemical Identifiers
| 175205-54-6 | |
| 279.054 | |
| NJXDBSSSDPOAFI-UHFFFAOYSA-N | |
| 2736675 | |
| C1=CC(=C(C=C1C(F)(F)F)Cl)S(=O)(=O)Cl |
| C7H3Cl2F3O2S | |
| MFCD00052912 | |
| 2-chloro-4-trifluoromethyl benzene-1-sulfonyl chloride, 2-chloro-4-trifluoromethyl benzenesulfonyl chloride, 2-chloro-4-trifluoromethyl benzenesulphonylchloride, 2-chloro-4-trifluoromethyl benzenesulphonyl chloride, 2-chloro-4-trifluoromethyl benzenesulfonylchloride, 2-chloro-4-trifluoromethyl benzenesulfonyl, 2-chloro-4-trifluoromethyl-benzenesulfonyl chloride, benzenesulfonyl chloride, 2-chloro-4-trifluoromethyl, pubchem5104, acmc-1bwmt | |
| 2-chloro-4-(trifluoromethyl)benzenesulfonyl chloride |
Specifications
| 2-Chloro-4-(trifluoromethyl)benzenesulfonyl chloride | |
| >110°C (230°F) | |
| Moisture sensitive | |
| 35°C to 39°C | |
| 175205-54-6 | |
| MFCD00052912 | |
| 2-chloro-4-trifluoromethyl benzene-1-sulfonyl chloride, 2-chloro-4-trifluoromethyl benzenesulfonyl chloride, 2-chloro-4-trifluoromethyl benzenesulphonylchloride, 2-chloro-4-trifluoromethyl benzenesulphonyl chloride, 2-chloro-4-trifluoromethyl benzenesulfonylchloride, 2-chloro-4-trifluoromethyl benzenesulfonyl, 2-chloro-4-trifluoromethyl-benzenesulfonyl chloride, benzenesulfonyl chloride, 2-chloro-4-trifluoromethyl, pubchem5104, acmc-1bwmt | |
| C1=CC(=C(C=C1C(F)(F)F)Cl)S(=O)(=O)Cl | |
| 279.054 | |
| 279.07 |
| 1.6 | |
| 1.575 | |
| 70°C to 71°C (0.5mmHg) | |
| 5g | |
| C7H3Cl2F3O2S | |
| UN3261 | |
| NJXDBSSSDPOAFI-UHFFFAOYSA-N | |
| 2-chloro-4-(trifluoromethyl)benzenesulfonyl chloride | |
| 2736675 | |
| 97% |