Learn More
2,4-Dichloro-6,7-dimethoxyquinazoline, 97%, ACROS Organics™
Brand: Acros Organics 342550250
Additional Details : CAS Number : 27631-29-4 Weight : 0.07500kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 25g |
Chemical Identifiers
| 27631-29-4 | |
| 259.086 | |
| DGHKCBSVAZXEPP-UHFFFAOYSA-N | |
| 520327 | |
| COC1=C(C=C2C(=C1)C(=NC(=N2)Cl)Cl)OC |
| C10H8Cl2N2O2 | |
| MFCD00051733 | |
| 2,4-dichloro-6,7-dimethoxy-quinazoline, 2,4-dichloro-6,7-dimethoxy quinazoline, quinazoline, 2,4-dichloro-6,7-dimethoxy, 2-chloro-6,7-dimethoxyquinazolin-4-yl chloride, quinazoline,2,4-dichloro-6,7-dimethoxy, doxazosin impurity e, doxazosin mesilate impurity e ep, pubchem9430, usp doxazosin related compound e usp, acmc-209gyd | |
| 2,4-dichloro-6,7-dimethoxyquinazoline |
Specifications
| 2, 4-Dichloro-6, 7-dimethoxyquinazoline | |
| Glass bottle | |
| 172°C to 177°C | |
| 97% | |
| 96.0 | |
| 97% | |
| MFCD00051733 | |
| DGHKCBSVAZXEPP-UHFFFAOYSA-N | |
| 2,4-dichloro-6,7-dimethoxyquinazoline | |
| 520327 | |
| Crystalline Powder |
| Authentic | |
| Beige to Yellow | |
| 25g | |
| 27631-29-4 | |
| 100.0 | |
| C10H8Cl2N2O2 | |
| 2,4-dichloro-6,7-dimethoxy-quinazoline, 2,4-dichloro-6,7-dimethoxy quinazoline, quinazoline, 2,4-dichloro-6,7-dimethoxy, 2-chloro-6,7-dimethoxyquinazolin-4-yl chloride, quinazoline,2,4-dichloro-6,7-dimethoxy, doxazosin impurity e, doxazosin mesilate impurity e ep, pubchem9430, usp doxazosin related compound e usp, acmc-209gyd | |
| COC1=C(C=C2C(=C1)C(=NC(=N2)Cl)Cl)OC | |
| 259.086 | |
| 259.09 | |
| ≥96.0% |
Safety and Handling
- 2,4-Dichloro-6,7-dimethoxyquinazoline
Signal Word
- Warning
Hazard Category
- Serious eye damage/eye irritation Category 2
- Skin corrosion/irritation Category 2
- Specific target organ toxicity Category 3
Hazard Statement
- H319-Causes serious eye irritation.
- H335-May cause respiratory irritation.
- H315-Causes skin irritation.
Precautionary Statement
- P261-Avoid breathing dust/fume/gas/mist/vapours/spray.
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P302+P352-IF ON SKIN: Wash with plenty of water/.
- P305+P351+P338-IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.