Learn More
1H-Benzimidazole-5-carboxylic acid, 98%, ACROS Organics™
Brand: Acros Organics 290870050
Additional Details : CAS Number : 15788-16-6 Weight : 0.05500kg
| Quantity | 5g |
|---|
Chemical Identifiers
| 15788-16-6 | |
| 162.15 | |
| COYPLDIXZODDDL-UHFFFAOYSA-N | |
| 459456 | |
| C1=CC2=C(C=C1C(=O)O)NC=N2 |
| C8H6N2O2 | |
| MFCD00011555 | |
| 1h-benzimidazole-5-carboxylic acid, 5-benzimidazolecarboxylic acid, benzimidazole-5-carboxylic acid, 1h-benzo d imidazole-5-carboxylic acid, 1h-benzimidazole-6-carboxylic acid, 5-carboxybenzimidazole, 1h-1,3-benzodiazole-5-carboxylic acid, 3h-benzo d imidazole-5-carboxylic acid, 1h-benzimidazole-5-carboxylicacid, 1h-1,3-benzodiazole-6-carboxylic acid | |
| 3H-benzimidazole-5-carboxylic acid |
Specifications
| 1H-Benzimidazole-5-carboxylic acid | |
| Glass bottle | |
| 2% max. (K.F.) | |
| >300°C | |
| 98% | |
| 97.5 | |
| 98% | |
| MFCD00011555 | |
| COYPLDIXZODDDL-UHFFFAOYSA-N | |
| 3H-benzimidazole-5-carboxylic acid | |
| 459456 | |
| Powder |
| Authentic | |
| 0.25% max. | |
| Brown-Gray to Gray-Green | |
| 5g | |
| 15788-16-6 | |
| 100.0 | |
| C8H6N2O2 | |
| 1h-benzimidazole-5-carboxylic acid, 5-benzimidazolecarboxylic acid, benzimidazole-5-carboxylic acid, 1h-benzo d imidazole-5-carboxylic acid, 1h-benzimidazole-6-carboxylic acid, 5-carboxybenzimidazole, 1h-1,3-benzodiazole-5-carboxylic acid, 3h-benzo d imidazole-5-carboxylic acid, 1h-benzimidazole-5-carboxylicacid, 1h-1,3-benzodiazole-6-carboxylic acid | |
| C1=CC2=C(C=C1C(=O)O)NC=N2 | |
| 162.15 | |
| 162.15 | |
| 98% |
Safety and Handling
- 1H-Benzimidazole-5-carboxylic acid
Signal Word
- Warning
Hazard Category
- Serious eye damage/eye irritation Category 2
- Skin corrosion/irritation Category 2
- Specific target organ toxicity Category 3
Hazard Statement
- H319-Causes serious eye irritation.
- H335-May cause respiratory irritation.
- H315-Causes skin irritation.
Precautionary Statement
- P261-Avoid breathing dust/fume/gas/mist/vapours/spray.
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P302+P352-IF ON SKIN: Wash with plenty of water/.
- P305+P351+P338-IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.