Få mere at vide
Nystatin, Thermo Scientific™
Nystatin, CAS # 1400-61-9, is a polyene compound that shows anti-bacterial and antifungal activities. It is also an ionophore that increases the membrane permeability to some ions.
Brand: Thermo Scientific Alfa Aesar J62486.09
| Mængde | 10g |
|---|
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Tekniske data
| Nystatin | |
| C47H75NO17 | |
| 10g | |
| Soluble in DMSO | |
| CC1C=CC=CCCC=CC=CC=CC=CC(CC2C(C(CC(O2)(CC(C(CCC(CC(CC(CC(=O)OC(C(C1O)C)C)O)O)O)O)O)O)O)C(=O)O)OC3C(C(C(C(O3)C)O)N)O | |
| 926.107 | |
| 926.09 |
| 1400-61-9 | |
| MFCD00036240 | |
| 14,6736 | |
| VQOXZBDYSJBXMA-AWCIUYGFSA-N | |
| (1S,3R,6Z,18S,19R,20S,21S,25S,27S,29S,32R,33S,35S,37S,38R)-3-[(2R,3S,4S,5S,6R)-4-amino-3,5-dihydroxy-6-methyloxan-2-yl]oxy-19,25,27,29,32,33,35,37-octahydroxy-18,20,21-trimethyl-23-oxo-22,39-dioxabicyclo[33.3.1]nonatriaconta-4,6,8,10,14,16-hexaene-38-carb | |
| 133640190 |
Dit input er vigtigt for os. Udfyld denne formular for at give feedback relateret til indholdet på dette produkt.