Learn More
1-(Diphenylmethyl)piperazine, 97%, ACROS Organics™
Brand: Acros Organics 122931000
Additional Details : CAS Number : 841-77-0 Weight : 0.15000kg
| Packaging | Plastic bottle |
|---|---|
| Quantity | 100g |
Chemical Identifiers
| 841-77-0 | |
| 252.361 | |
| NWVNXDKZIQLBNM-UHFFFAOYSA-N | |
| 70048 | |
| C1CN(CCN1)C(C2=CC=CC=C2)C3=CC=CC=C3 |
| C17H20N2 | |
| MFCD00038379 | |
| 1-diphenylmethyl piperazine, benzhydrylpiperazine, n-benzhydrylpiperazine, 1-benzhydryl-piperazine, diphenylmethylpiperazine, norcyclizine, normethylcyclizine, piperazine, 1-diphenylmethyl, 4-benzhydrylpiperazine, n-diphenylmethyl piperazine | |
| 1-benzhydrylpiperazine |
Specifications
| 1-(Diphenylmethyl)piperazine | |
| Plastic bottle | |
| White to Yellow | |
| 100g | |
| 841-77-0 | |
| 100.0 | |
| C17H20N2 | |
| 1-diphenylmethyl piperazine, benzhydrylpiperazine, n-benzhydrylpiperazine, 1-benzhydryl-piperazine, diphenylmethylpiperazine, norcyclizine, normethylcyclizine, piperazine, 1-diphenylmethyl, 4-benzhydrylpiperazine, n-diphenylmethyl piperazine | |
| C1CN(CCN1)C(C2=CC=CC=C2)C3=CC=CC=C3 | |
| 252.361 | |
| 252.36 | |
| ≥96.0% Total Base (on dry substance), ≥98.0% (TLC) |
| Authentic | |
| 2% max. (K.F.) | |
| 88°C to 93°C | |
| 97% | |
| 96.0 | |
| 97% | |
| MFCD00038379 | |
| NWVNXDKZIQLBNM-UHFFFAOYSA-N | |
| 1-benzhydrylpiperazine | |
| 70048 | |
| Crystalline Powder |
Safety and Handling
- 1-(Diphenylmethyl)piperazine
Signal Word
- Warning
Hazard Category
- Acute toxicity Category 4
Hazard Statement
- H302-Harmful if swallowed.
Precautionary Statement
- P301+P312-IF SWALLOWED: Call a POISON CENTER or doctor/physician/ if you feel unwell.