Learn More
1-Benzyl-3-carbethoxy-4-piperidone hydrochloride, 97%, ACROS Organics™
Brand: Acros Organics 105900250
Additional Details : CAS Number : 1454-53-1 Weight : 0.07500kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 25g |
Chemical Identifiers
| 1454-53-1 | |
| 297.77 | |
| YPFMNHZRNXPYBG-UHFFFAOYSA-N | |
| 102623 | |
| CCOC(=O)C1CN(CCC1=O)CC2=CC=CC=C2.Cl |
| C15H19NO3·HCl | |
| MFCD00012800 | |
| ethyl 1-benzyl-4-oxopiperidine-3-carboxylate hydrochloride, 1-benzyl-3-carbethoxy-4-piperidone hydrochloride, ethyl 1-benzyl-4-oxo-3-piperidinecarboxylate hydrochloride, 1-benzyl-3-ethoxycarbonyl-4-piperidone hydrochloride, 1-benzyl-3-carbethoxy-4-piperidone hcl, 1-benzyl-3-carbethoxy-piperidone hcl, 1-benzyl-3-ethoxycarbonyl-4-piperidone hcl, 1-benzyl-3-carboethoxy-4-piperidone hydrochloride, 1-benzyl-3-ethoxycarbonyl-4-oxopiperidine hydrochloride | |
| ethyl 1-benzyl-4-oxopiperidine-3-carboxylate;hydrochloride |
Specifications
| 1-Benzyl-3-carbethoxy-4-piperidone hydrochloride | |
| Glass bottle | |
| Cream to Pink | |
| 25g | |
| 1454-53-1 | |
| 100.0 | |
| C15H19NO3·HCl | |
| 22, II, 216 | |
| YPFMNHZRNXPYBG-UHFFFAOYSA-N | |
| ethyl 1-benzyl-4-oxopiperidine-3-carboxylate;hydrochloride | |
| 102623 | |
| Powder |
| Authentic | |
| 12% max. (K.F.) | |
| 160.0°C to 170.0°C | |
| 97% | |
| 96.0 | |
| 96% min. (on dry substance) (Argentometry) | |
| MFCD00012800 | |
| ethyl 1-benzyl-4-oxopiperidine-3-carboxylate hydrochloride, 1-benzyl-3-carbethoxy-4-piperidone hydrochloride, ethyl 1-benzyl-4-oxo-3-piperidinecarboxylate hydrochloride, 1-benzyl-3-ethoxycarbonyl-4-piperidone hydrochloride, 1-benzyl-3-carbethoxy-4-piperidone hcl, 1-benzyl-3-carbethoxy-piperidone hcl, 1-benzyl-3-ethoxycarbonyl-4-piperidone hcl, 1-benzyl-3-carboethoxy-4-piperidone hydrochloride, 1-benzyl-3-ethoxycarbonyl-4-oxopiperidine hydrochloride | |
| CCOC(=O)C1CN(CCC1=O)CC2=CC=CC=C2.Cl | |
| 297.77 | |
| 297.77 | |
| 97% |
Safety and Handling
- 1-Benzyl-3-carbethoxy-4-piperidone hydrochloride
Signal Word
- Warning
Hazard Category
- Serious eye damage/eye irritation Category 2
- Skin corrosion/irritation Category 2
- Specific target organ toxicity Category 3
Hazard Statement
- H319-Causes serious eye irritation.
- H335-May cause respiratory irritation.
- H315-Causes skin irritation.
Precautionary Statement
- P261-Avoid breathing dust/fume/gas/mist/vapours/spray.
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P302+P352-IF ON SKIN: Wash with plenty of water/.
- P305+P351+P338-IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.