Learn More
Alfa Aesar™ 1-Adamantyl methyl ketone, 99%
Brand: Alfa Aesar™ H55889.03
Additional Details : CAS Number : 1660-04-4 Weight : 0.00100kg
| Quantity | 1g |
|---|
Description
Applications1-Adamantyl methyl ketone, is used as an important raw material and intermediate used in organic Synthesis, pharmaceuticals, agrochemicals and dyestuff.
Solubility
Soluble in methanol- very faint turbidity. Insoluble in water.
Notes
Keep container tightly closed in a dry and well-ventilated place. Stable under recommended storage conditions. Keep away from strong oxidizing agents. Stable under normal temperatures and pressures.
Chemical Identifiers
| 1660-04-4 | |
| 178.275 | |
| DACIGVIOAFXPHW-UHFFFAOYSA-N | |
| 123126 | |
| CC(=O)C12CC3CC(C1)CC(C3)C2 |
| C12H18O | |
| MFCD00074739 | |
| 1-adamantyl methyl ketone, 1-acetyladamantane, 1-1-adamantyl ethanone, 1-adamantylmethylketone, 1-adamantan-1-yl ethan-1-one, 1-adamantan-1-yl ethanone, acetyladamantane, methyl 1-adamantyl ketone, 1-adamantan-1-yl-ethanone, adamantyl methyl ketone | |
| 1-(1-adamantyl)ethanone |
Specifications
| 1-Adamantyl methyl ketone | |
| 53°C to 55°C | |
| 1660-04-4 | |
| MFCD00074739 | |
| Soluble in methanol- very faint turbidity. Insoluble in water. | |
| CC(=O)C12CC3CC(C1)CC(C3)C2 | |
| 178.275 | |
| 178.27 |
| 108°C (226°F) | |
| 1g | |
| C12H18O | |
| 1-adamantyl methyl ketone, 1-acetyladamantane, 1-1-adamantyl ethanone, 1-adamantylmethylketone, 1-adamantan-1-yl ethan-1-one, 1-adamantan-1-yl ethanone, acetyladamantane, methyl 1-adamantyl ketone, 1-adamantan-1-yl-ethanone, adamantyl methyl ketone | |
| DACIGVIOAFXPHW-UHFFFAOYSA-N | |
| 1-(1-adamantyl)ethanone | |
| 123126 | |
| 99% |