Learn More
1,2-Bis(trimethylsilyloxy)ethane, 98%, ACROS Organics™
Brand: Acros Organics 209580500
Additional Details : CAS Number : 7381-30-8 Weight : 0.10000kg Transport : UN number : 1993 Chem class : 3 Pack group : III
| Packaging | Glass bottle |
|---|---|
| Quantity | 50g |
Chemical Identifiers
| 7381-30-8 | |
| 206.43 | |
| JGWFUSVYECJQDT-UHFFFAOYSA-N | |
| 81858 | |
| C[Si](C)(C)OCCO[Si](C)(C)C |
| C8H22O2Si2 | |
| MFCD00009640 | |
| 1,2-bis trimethylsiloxy ethane, 1,2-bis trimethylsilyloxy ethane, 2,2,7,7-tetramethyl-3,6-dioxa-2,7-disilaoctane, ethylene glycol bis trimethylsilyl ether, ethylenedioxybis trimethylsilane, 3,6-dioxa-2,7-disilaoctane, 2,2,7,7-tetramethyl, 1,2-bis-trimethylsilyloxy ethane, 1,2-bis-trimethylsilanyloxy-ethane, ethylene glycol, di-tms, acmc-1bh50 | |
| trimethyl(2-trimethylsilyloxyethoxy)silane |
Specifications
| 1, 2-Bis(trimethylsilyloxy)ethane | |
| 46°C | |
| Glass bottle | |
| 0.84 | |
| Colorless to Yellow | |
| 7381-30-8 | |
| 100.0 | |
| C8H22O2Si2 | |
| MFCD00009640 | |
| JGWFUSVYECJQDT-UHFFFAOYSA-N | |
| trimethyl(2-trimethylsilyloxyethoxy)silane | |
| 81858 | |
| Liquid |
| 0.8400g/mL | |
| Authentic | |
| 1.4020 to 1.404 | |
| 165°C to 166°C | |
| 50g | |
| 97.5 | |
| 98% | |
| (CH3)3SiOCH2CH2OSi(CH3)3 | |
| 1,2-bis trimethylsiloxy ethane, 1,2-bis trimethylsilyloxy ethane, 2,2,7,7-tetramethyl-3,6-dioxa-2,7-disilaoctane, ethylene glycol bis trimethylsilyl ether, ethylenedioxybis trimethylsilane, 3,6-dioxa-2,7-disilaoctane, 2,2,7,7-tetramethyl, 1,2-bis-trimethylsilyloxy ethane, 1,2-bis-trimethylsilanyloxy-ethane, ethylene glycol, di-tms, acmc-1bh50 | |
| C[Si](C)(C)OCCO[Si](C)(C)C | |
| 206.43 | |
| 206.43 | |
| 98% |
Safety and Handling
- 1,2-Bis(trimethylsilyloxy)ethane
Signal Word
- Warning
Hazard Category
- Flammable liquid Category 3
Hazard Statement
- H226-Flammable liquid and vapour.
Precautionary Statement
- P210-Keep away from heat, hot surfaces, sparks, open flames and other ignition sources. No smoking.
- P240-Ground/bond container and receiving equipment.