Filtrerede søgeresultater
Taurodeoxycholsyre, natriumsalthydrat, 97%, Thermo Scientific Chemicals
CAS: 207737-97-1 Molekylær formel: C26H44NNaO6S Molekylvægt (g/mol): 521.69 MDL nummer: MFCD00149238 InChI nøgle: YXHRQQJFKOHLAP-FVCKGWAHSA-M Synonym: Sodium taurodeoxylate PubChem CID: 23702150 IUPAC navn: natrium;2-[[(4R)-4-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11, 12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethansulfonat;hydrat SMIL: [Na+].[H][C@@]12CC[C@H]([C@H](C)CCC(=O)NCCS([O-])(=O)=O)[C@@]1(C)[C@@H](O)C[C@@]1([H])[C@@]2([H])CC[C@]2([H])C[C@H](O)CC[C@]12C
| MDL nummer | MFCD00149238 |
|---|---|
| PubChem CID | 23702150 |
| Molekylvægt (g/mol) | 521.69 |
| CAS | 207737-97-1 |
| Synonym | Sodium taurodeoxylate |
| SMIL | [Na+].[H][C@@]12CC[C@H]([C@H](C)CCC(=O)NCCS([O-])(=O)=O)[C@@]1(C)[C@@H](O)C[C@@]1([H])[C@@]2([H])CC[C@]2([H])C[C@H](O)CC[C@]12C |
| IUPAC navn | natrium;2-[[(4R)-4-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11, 12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethansulfonat;hydrat |
| InChI nøgle | YXHRQQJFKOHLAP-FVCKGWAHSA-M |
| Molekylær formel | C26H44NNaO6S |
IGEPAL∣r CA-630
CAS: 9002-93-1 Molekylær formel: C16H26O2 Molekylvægt (g/mol): 250.38 MDL nummer: MFCD00132505 InChI nøgle: JYCQQPHGFMYQCF-UHFFFAOYSA-N Synonym: Octylphenyl-polyethylene glycol IUPAC navn: 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethan-1-ol SMIL: CC(C)(C)CC(C)(C)C1=CC=C(OCCO)C=C1
| MDL nummer | MFCD00132505 |
|---|---|
| Molekylvægt (g/mol) | 250.38 |
| CAS | 9002-93-1 |
| Synonym | Octylphenyl-polyethylene glycol |
| SMIL | CC(C)(C)CC(C)(C)C1=CC=C(OCCO)C=C1 |
| IUPAC navn | 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethan-1-ol |
| InChI nøgle | JYCQQPHGFMYQCF-UHFFFAOYSA-N |
| Molekylær formel | C16H26O2 |
Thermo Scientific™ PCC-54™ Vaskemiddelkoncentrat
En laboratorierengøringsopløsning til laboratorieredskaber, overfladematerialer og glasvarer, inklusive bægre, pipetter, linser, spejle; RBS-35 alternativ.
| Sammensætning | PCC-PFree, 2%- 20% Solution |
|---|---|
| Form | Liquid |
| Oversigt | PCC-54 Detergent Concentrate |
| Indhold og opbevaring | Store in original container protected from direct sunlight in a dry, cool and well-ventilated area, between the following temperatures: 20 to 25°C. |
| Volumen (metrisk) | 3 L |
| Produktlinje | PCC-54™ |
Thermo Scientific™ PCC-Pfree™ Vaskemiddelkoncentrat
En fosfatfri, overfladeaktivt stofbaseret rengøringsopløsning til brug på mange laboratorieoverflader og glasvarer; RBS pF-alternativ for Europa.
Molecular Probes™ Pluronic™ F-127, 0,2μ m filtreret (10 % opløsning i vand)
Pluronic™ F-127, 0,2μ m filtreret (10 % opløsning i vand)
Molecular Probes™ Pluronic™ F-127 (20 % opløsning i DMSO)
Pluronic™ F-127 (20 % opløsning i DMSO)